![]() |
Name |
3-hydroxyepicoccone B
|
Molecular Formula | C9H8O6 | |
IUPAC Name* |
3,5,6,7-tetrahydroxy-4-methyl-3H-2-benzofuran-1-one
|
|
SMILES |
Cc1c(O)c(O)c(O)c2c1C(O)OC2=O
|
|
InChI |
InChI=1S/C9H8O6/c1-2-3-4(9(14)15-8(3)13)6(11)7(12)5(2)10/h8,10-13H,1H3
|
|
InChIKey |
LRJRRFDRIJYNQL-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 212.16 | ALogp: | 0.3 |
HBD: | 4 | HBA: | 6 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 107.2 | Aromatic Rings: | 2 |
Heavy Atoms: | 15 | QED Weighted: | 0.372 |
Caco-2 Permeability: | -5.498 | MDCK Permeability: | 0.00000399 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.014 |
Human Intestinal Absorption (HIA): | 0.034 | 20% Bioavailability (F20%): | 0.056 |
30% Bioavailability (F30%): | 0.097 |
Blood-Brain-Barrier Penetration (BBB): | 0.015 | Plasma Protein Binding (PPB): | 95.97% |
Volume Distribution (VD): | 0.619 | Fu: | 12.42% |
CYP1A2-inhibitor: | 0.075 | CYP1A2-substrate: | 0.128 |
CYP2C19-inhibitor: | 0.01 | CYP2C19-substrate: | 0.051 |
CYP2C9-inhibitor: | 0.239 | CYP2C9-substrate: | 0.239 |
CYP2D6-inhibitor: | 0.016 | CYP2D6-substrate: | 0.146 |
CYP3A4-inhibitor: | 0.011 | CYP3A4-substrate: | 0.024 |
Clearance (CL): | 11.474 | Half-life (T1/2): | 0.932 |
hERG Blockers: | 0.001 | Human Hepatotoxicity (H-HT): | 0.169 |
Drug-inuced Liver Injury (DILI): | 0.855 | AMES Toxicity: | 0.136 |
Rat Oral Acute Toxicity: | 0.044 | Maximum Recommended Daily Dose: | 0.023 |
Skin Sensitization: | 0.912 | Carcinogencity: | 0.226 |
Eye Corrosion: | 0.837 | Eye Irritation: | 0.887 |
Respiratory Toxicity: | 0.124 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003702 | ![]() |
0.588 | D07AHW | ![]() |
0.273 | ||
ENC004202 | ![]() |
0.559 | D07MGA | ![]() |
0.250 | ||
ENC004201 | ![]() |
0.557 | D0K8KX | ![]() |
0.222 | ||
ENC003016 | ![]() |
0.551 | D04AIT | ![]() |
0.213 | ||
ENC004984 | ![]() |
0.520 | D0R9WP | ![]() |
0.206 | ||
ENC004506 | ![]() |
0.520 | D0YH0N | ![]() |
0.203 | ||
ENC002023 | ![]() |
0.520 | D01XDL | ![]() |
0.202 | ||
ENC005912 | ![]() |
0.474 | D0H6QU | ![]() |
0.200 | ||
ENC004367 | ![]() |
0.474 | D0WY9N | ![]() |
0.198 | ||
ENC005911 | ![]() |
0.474 | D0H1AR | ![]() |
0.194 |