![]() |
Name |
4,5,6-trihydroxy-7-methyl phthalide
|
Molecular Formula | C9H8O5 | |
IUPAC Name* |
4,5,6-trihydroxy-7-methyl-3H-2-benzofuran-1-one
|
|
SMILES |
Cc1c(O)c(O)c(O)c2c1C(=O)OC2
|
|
InChI |
InChI=1S/C9H8O5/c1-3-5-4(2-14-9(5)13)7(11)8(12)6(3)10/h10-12H,2H2,1H3
|
|
InChIKey |
RABLYBQDMDORFH-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 196.16 | ALogp: | 0.8 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 87.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 14 | QED Weighted: | 0.428 |
Caco-2 Permeability: | -5.308 | MDCK Permeability: | 0.00000524 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.03 |
Human Intestinal Absorption (HIA): | 0.014 | 20% Bioavailability (F20%): | 0.218 |
30% Bioavailability (F30%): | 0.101 |
Blood-Brain-Barrier Penetration (BBB): | 0.013 | Plasma Protein Binding (PPB): | 97.23% |
Volume Distribution (VD): | 0.472 | Fu: | 9.65% |
CYP1A2-inhibitor: | 0.143 | CYP1A2-substrate: | 0.229 |
CYP2C19-inhibitor: | 0.015 | CYP2C19-substrate: | 0.055 |
CYP2C9-inhibitor: | 0.281 | CYP2C9-substrate: | 0.173 |
CYP2D6-inhibitor: | 0.059 | CYP2D6-substrate: | 0.159 |
CYP3A4-inhibitor: | 0.021 | CYP3A4-substrate: | 0.045 |
Clearance (CL): | 15.775 | Half-life (T1/2): | 0.934 |
hERG Blockers: | 0.01 | Human Hepatotoxicity (H-HT): | 0.19 |
Drug-inuced Liver Injury (DILI): | 0.319 | AMES Toxicity: | 0.031 |
Rat Oral Acute Toxicity: | 0.162 | Maximum Recommended Daily Dose: | 0.068 |
Skin Sensitization: | 0.94 | Carcinogencity: | 0.716 |
Eye Corrosion: | 0.459 | Eye Irritation: | 0.911 |
Respiratory Toxicity: | 0.13 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002023 | ![]() |
1.000 | D04FBR | ![]() |
0.253 | ||
ENC004506 | ![]() |
1.000 | D07MGA | ![]() |
0.241 | ||
ENC003016 | ![]() |
0.805 | D07AHW | ![]() |
0.214 | ||
ENC002722 | ![]() |
0.674 | D0K8KX | ![]() |
0.213 | ||
ENC003029 | ![]() |
0.609 | D04AIT | ![]() |
0.203 | ||
ENC004504 | ![]() |
0.604 | D0R6BI | ![]() |
0.200 | ||
ENC005913 | ![]() |
0.571 | D0YH0N | ![]() |
0.192 | ||
ENC003354 | ![]() |
0.571 | D0WY9N | ![]() |
0.190 | ||
ENC004362 | ![]() |
0.571 | D0H6QU | ![]() |
0.190 | ||
ENC005415 | ![]() |
0.532 | D0N0OU | ![]() |
0.189 |