![]() |
Name |
Cylindrocarpone C
|
Molecular Formula | C13H10O7 | |
IUPAC Name* |
4,6,7,8,12-pentahydroxy-10-methyl-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-2-one
|
|
SMILES |
CC1=CC(=C2C3=C1C(=C(C(=C3C(OC2=O)O)O)O)O)O
|
|
InChI |
InChI=1S/C13H10O7/c1-3-2-4(14)6-7-5(3)9(15)11(17)10(16)8(7)13(19)20-12(6)18/h2,13-17,19H,1H3
|
|
InChIKey |
ZIAHWGCHZFUTMT-UHFFFAOYSA-N
|
|
Synonyms |
Cylindrocarpone C
|
|
CAS | NA | |
PubChem CID | 146684369 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 278.21 | ALogp: | 1.5 |
HBD: | 5 | HBA: | 7 |
Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 127.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 20 | QED Weighted: | 0.365 |
Caco-2 Permeability: | -5.822 | MDCK Permeability: | 0.00000374 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.057 |
Human Intestinal Absorption (HIA): | 0.801 | 20% Bioavailability (F20%): | 0.05 |
30% Bioavailability (F30%): | 0.986 |
Blood-Brain-Barrier Penetration (BBB): | 0.017 | Plasma Protein Binding (PPB): | 96.63% |
Volume Distribution (VD): | 0.686 | Fu: | 9.46% |
CYP1A2-inhibitor: | 0.311 | CYP1A2-substrate: | 0.149 |
CYP2C19-inhibitor: | 0.024 | CYP2C19-substrate: | 0.061 |
CYP2C9-inhibitor: | 0.203 | CYP2C9-substrate: | 0.432 |
CYP2D6-inhibitor: | 0.102 | CYP2D6-substrate: | 0.151 |
CYP3A4-inhibitor: | 0.045 | CYP3A4-substrate: | 0.043 |
Clearance (CL): | 3.415 | Half-life (T1/2): | 0.925 |
hERG Blockers: | 0.003 | Human Hepatotoxicity (H-HT): | 0.044 |
Drug-inuced Liver Injury (DILI): | 0.947 | AMES Toxicity: | 0.7 |
Rat Oral Acute Toxicity: | 0.021 | Maximum Recommended Daily Dose: | 0.817 |
Skin Sensitization: | 0.867 | Carcinogencity: | 0.145 |
Eye Corrosion: | 0.005 | Eye Irritation: | 0.917 |
Respiratory Toxicity: | 0.146 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004200 | ![]() |
0.597 | D0K8KX | ![]() |
0.314 | ||
ENC004201 | ![]() |
0.580 | D07MGA | ![]() |
0.281 | ||
ENC004924 | ![]() |
0.559 | D04AIT | ![]() |
0.276 | ||
ENC003702 | ![]() |
0.439 | D0AZ8C | ![]() |
0.248 | ||
ENC002018 | ![]() |
0.427 | D0R9WP | ![]() |
0.245 | ||
ENC002003 | ![]() |
0.397 | D0H1AR | ![]() |
0.234 | ||
ENC004989 | ![]() |
0.397 | D06GCK | ![]() |
0.232 | ||
ENC000335 | ![]() |
0.380 | D07JHH | ![]() |
0.230 | ||
ENC004923 | ![]() |
0.380 | D0S0LZ | ![]() |
0.223 | ||
ENC004991 | ![]() |
0.377 | D0R6RC | ![]() |
0.219 |