|
Name |
25-Hydroxyergosta-4,6,8(14),22-tetraen-3-one
|
| Molecular Formula | C28H40O2 | |
| IUPAC Name* |
(10R,13R,17R)-17-[(E,2R)-6-hydroxy-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-1,2,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-3-one
|
|
| SMILES |
C[C@H](/C=C/C(C)C(C)(C)O)[C@H]1CCC2=C3C=CC4=CC(=O)CC[C@@]4(C3CC[C@]12C)C
|
|
| InChI |
InChI=1S/C28H40O2/c1-18(7-8-19(2)26(3,4)30)23-11-12-24-22-10-9-20-17-21(29)13-15-27(20,5)25(22)14-16-28(23,24)6/h7-10,17-19,23,25,30H,11-16H2,1-6H3/b8-7+/t18-,19?,23-,25?,27+,28-/m1/s1
|
|
| InChIKey |
UDQKCPDBYOLCPB-AXCHQRLPSA-N
|
|
| Synonyms |
25-hydroxyergosta-4,6,8(14),22-tetraen-3-one
|
|
| CAS | NA | |
| PubChem CID | 139587359 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 408.6 | ALogp: | 5.4 |
| HBD: | 1 | HBA: | 2 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 37.3 | Aromatic Rings: | 4 |
| Heavy Atoms: | 30 | QED Weighted: | 0.537 |
| Caco-2 Permeability: | -4.902 | MDCK Permeability: | 0.00002050 |
| Pgp-inhibitor: | 0.999 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.031 | 20% Bioavailability (F20%): | 0.917 |
| 30% Bioavailability (F30%): | 0.047 |
| Blood-Brain-Barrier Penetration (BBB): | 0.014 | Plasma Protein Binding (PPB): | 93.33% |
| Volume Distribution (VD): | 1.906 | Fu: | 1.60% |
| CYP1A2-inhibitor: | 0.041 | CYP1A2-substrate: | 0.724 |
| CYP2C19-inhibitor: | 0.235 | CYP2C19-substrate: | 0.949 |
| CYP2C9-inhibitor: | 0.443 | CYP2C9-substrate: | 0.472 |
| CYP2D6-inhibitor: | 0.151 | CYP2D6-substrate: | 0.722 |
| CYP3A4-inhibitor: | 0.919 | CYP3A4-substrate: | 0.902 |
| Clearance (CL): | 0.953 | Half-life (T1/2): | 0.272 |
| hERG Blockers: | 0.407 | Human Hepatotoxicity (H-HT): | 0.268 |
| Drug-inuced Liver Injury (DILI): | 0.101 | AMES Toxicity: | 0.009 |
| Rat Oral Acute Toxicity: | 0.423 | Maximum Recommended Daily Dose: | 0.945 |
| Skin Sensitization: | 0.933 | Carcinogencity: | 0.038 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.013 |
| Respiratory Toxicity: | 0.943 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004998 | ![]() |
0.835 | D0N1TP | ![]() |
0.367 | ||
| ENC003880 | ![]() |
0.822 | D0G8BV | ![]() |
0.339 | ||
| ENC001861 | ![]() |
0.800 | D0F1UL | ![]() |
0.339 | ||
| ENC004737 | ![]() |
0.800 | D04GJN | ![]() |
0.304 | ||
| ENC004022 | ![]() |
0.800 | D0Z1XD | ![]() |
0.300 | ||
| ENC003368 | ![]() |
0.774 | D06JPB | ![]() |
0.296 | ||
| ENC003667 | ![]() |
0.742 | D06XMU | ![]() |
0.294 | ||
| ENC004834 | ![]() |
0.708 | D0W5LS | ![]() |
0.291 | ||
| ENC004366 | ![]() |
0.631 | D04ATM | ![]() |
0.291 | ||
| ENC005009 | ![]() |
0.624 | D0G8OC | ![]() |
0.286 | ||