|
Name |
(22E)-ergosta-4,6,8(14),22,24(28)-pentaen-3-one
|
| Molecular Formula | C28H38O | |
| IUPAC Name* |
(9R,10R,13R,17R)-10,13-dimethyl-17-[(E,2R)-6-methyl-5-methylidenehept-3-en-2-yl]-1,2,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-3-one
|
|
| SMILES |
C[C@H](/C=C/C(=C)C(C)C)[C@H]1CCC2=C3C=CC4=CC(=O)CC[C@@]4([C@H]3CC[C@]12C)C
|
|
| InChI |
InChI=1S/C28H38O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h7-10,17-18,20,24,26H,3,11-16H2,1-2,4-6H3/b8-7+/t20-,24-,26+,27+,28-/m1/s1
|
|
| InChIKey |
TVHXCCXWQYICOI-FCXPTMTQSA-N
|
|
| Synonyms |
(22E)-ergosta-4,6,8(14),22,24(28)-pentaen-3-one
|
|
| CAS | NA | |
| PubChem CID | 139585734 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 390.6 | ALogp: | 7.0 |
| HBD: | 0 | HBA: | 1 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 17.1 | Aromatic Rings: | 4 |
| Heavy Atoms: | 29 | QED Weighted: | 0.455 |
| Caco-2 Permeability: | -5.167 | MDCK Permeability: | 0.00001570 |
| Pgp-inhibitor: | 1 | Pgp-substrate: | 0 |
| Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.059 |
| 30% Bioavailability (F30%): | 0.435 |
| Blood-Brain-Barrier Penetration (BBB): | 0.002 | Plasma Protein Binding (PPB): | 94.79% |
| Volume Distribution (VD): | 1.448 | Fu: | 2.32% |
| CYP1A2-inhibitor: | 0.269 | CYP1A2-substrate: | 0.843 |
| CYP2C19-inhibitor: | 0.779 | CYP2C19-substrate: | 0.935 |
| CYP2C9-inhibitor: | 0.788 | CYP2C9-substrate: | 0.613 |
| CYP2D6-inhibitor: | 0.83 | CYP2D6-substrate: | 0.789 |
| CYP3A4-inhibitor: | 0.935 | CYP3A4-substrate: | 0.883 |
| Clearance (CL): | 1.652 | Half-life (T1/2): | 0.406 |
| hERG Blockers: | 0.298 | Human Hepatotoxicity (H-HT): | 0.137 |
| Drug-inuced Liver Injury (DILI): | 0.343 | AMES Toxicity: | 0.029 |
| Rat Oral Acute Toxicity: | 0.168 | Maximum Recommended Daily Dose: | 0.943 |
| Skin Sensitization: | 0.965 | Carcinogencity: | 0.186 |
| Eye Corrosion: | 0.005 | Eye Irritation: | 0.13 |
| Respiratory Toxicity: | 0.949 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001861 | ![]() |
0.778 | D0F1UL | ![]() |
0.358 | ||
| ENC004022 | ![]() |
0.778 | D0G8BV | ![]() |
0.346 | ||
| ENC004737 | ![]() |
0.778 | D04GJN | ![]() |
0.310 | ||
| ENC003880 | ![]() |
0.761 | D07BSQ | ![]() |
0.297 | ||
| ENC003368 | ![]() |
0.753 | D04ATM | ![]() |
0.296 | ||
| ENC003739 | ![]() |
0.742 | D0Z1XD | ![]() |
0.294 | ||
| ENC004998 | ![]() |
0.701 | D06JPB | ![]() |
0.290 | ||
| ENC004834 | ![]() |
0.653 | D06XMU | ![]() |
0.287 | ||
| ENC005009 | ![]() |
0.636 | D0I2SD | ![]() |
0.287 | ||
| ENC004736 | ![]() |
0.584 | D0D2VS | ![]() |
0.282 | ||