|
Name |
Lobophorin G
|
| Molecular Formula | C63H94N2O20 | |
| IUPAC Name* |
[(1S,3R,6S,7E,9S,11E,13S,16S,17S,18S,20S,21R,22S)-9-[(2R,4S,5R,6R)-4-amino-5-(methoxycarbonylamino)-4,6-dimethyloxan-2-yl]oxy-23-hydroxy-17-[(2R,4R,5S,6S)-5-hydroxy-4-[(2S,4R,5R,6S)-4-hydroxy-5-[(2R,4R,5R,6S)-4-hydroxy-5-methoxy-6-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-3,8,12,18,20,22-hexamethyl-25,27-dioxo-26-oxapentacyclo[22.2.1.01,6.013,22.016,21]heptacosa-4,7,11,14,23-pentaen-4-yl]methyl acetate
|
|
| SMILES |
C[C@H]1C[C@@H]([C@@H]([C@@H]2[C@@H]1[C@]3([C@@H](C=C2)/C(=C/C[C@@H](/C(=C/[C@@H]4C=C([C@@H](C[C@@]45C(=O)C(=C3O)C(=O)O5)C)COC(=O)C)/C)O[C@H]6C[C@]([C@H]([C@H](O6)C)NC(=O)OC)(C)N)/C)C)O[C@H]7C[C@H]([C@H]([C@@H](O7)C)O)O[C@H]8C[C@H]([C@H]([C@@H](O8)C)O[C@@H]9C[C@H]([C@H]([C@@H](O9)C)OC)O)O)C
|
|
| InChI |
InChI=1S/C63H94N2O20/c1-28-15-18-44(81-49-26-61(11,64)56(36(9)80-49)65-60(73)75-14)29(2)20-39-21-38(27-76-37(10)66)32(5)25-63(39)58(71)50(59(72)85-63)57(70)62(12)41(28)17-16-40-51(62)30(3)19-31(4)53(40)83-48-24-45(52(69)33(6)77-48)82-46-23-43(68)55(35(8)79-46)84-47-22-42(67)54(74-13)34(7)78-47/h15-17,20-21,30-36,39-49,51-56,67-70H,18-19,22-27,64H2,1-14H3,(H,65,73)/b28-15+,29-20+,57-50?/t30-,31-,32+,33-,34-,35-,36+,39+,40-,41-,42+,43+,44-,45+,46-,47+,48-,49-,51+,52-,53-,54-,55-,56-,61-,62+,63-/m0/s1
|
|
| InChIKey |
IPTYHTNWIMMXNG-XVWWUPRYSA-N
|
|
| Synonyms |
Lobophorin G
|
|
| CAS | NA | |
| PubChem CID | 102190088 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 1199.4 | ALogp: | 4.3 |
| HBD: | 6 | HBA: | 21 |
| Rotatable Bonds: | 14 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 298.0 | Aromatic Rings: | 9 |
| Heavy Atoms: | 85 | QED Weighted: | 0.057 |
| Caco-2 Permeability: | -5.753 | MDCK Permeability: | 0.00069453 |
| Pgp-inhibitor: | 0.347 | Pgp-substrate: | 1 |
| Human Intestinal Absorption (HIA): | 0.93 | 20% Bioavailability (F20%): | 0.006 |
| 30% Bioavailability (F30%): | 0.961 |
| Blood-Brain-Barrier Penetration (BBB): | 0.003 | Plasma Protein Binding (PPB): | 83.84% |
| Volume Distribution (VD): | 0.961 | Fu: | 11.02% |
| CYP1A2-inhibitor: | 0 | CYP1A2-substrate: | 0.665 |
| CYP2C19-inhibitor: | 0.014 | CYP2C19-substrate: | 0.589 |
| CYP2C9-inhibitor: | 0.006 | CYP2C9-substrate: | 0 |
| CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.043 |
| CYP3A4-inhibitor: | 0.895 | CYP3A4-substrate: | 0.927 |
| Clearance (CL): | 6.192 | Half-life (T1/2): | 0.02 |
| hERG Blockers: | 0.332 | Human Hepatotoxicity (H-HT): | 0.909 |
| Drug-inuced Liver Injury (DILI): | 0.978 | AMES Toxicity: | 0.975 |
| Rat Oral Acute Toxicity: | 0.727 | Maximum Recommended Daily Dose: | 1 |
| Skin Sensitization: | 0.232 | Carcinogencity: | 0.084 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.003 |
| Respiratory Toxicity: | 0.987 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003727 | ![]() |
0.924 | D03KTD | ![]() |
0.419 | ||
| ENC004223 | ![]() |
0.924 | D0P6IK | ![]() |
0.369 | ||
| ENC003877 | ![]() |
0.866 | D0SL2V | ![]() |
0.365 | ||
| ENC003730 | ![]() |
0.854 | D09HTS | ![]() |
0.362 | ||
| ENC003621 | ![]() |
0.837 | D06EPF | ![]() |
0.360 | ||
| ENC004292 | ![]() |
0.824 | D0L4SD | ![]() |
0.360 | ||
| ENC004293 | ![]() |
0.734 | D0V3GA | ![]() |
0.358 | ||
| ENC004294 | ![]() |
0.732 | D09YHJ | ![]() |
0.347 | ||
| ENC003639 | ![]() |
0.713 | D0M9QK | ![]() |
0.341 | ||
| ENC003260 | ![]() |
0.582 | D07TGN | ![]() |
0.334 | ||