|
Name |
Lobophorin CR1
|
| Molecular Formula | C61H91NO20 | |
| IUPAC Name* |
methyl N-[(2R,3S,4S,6R)-4-hydroxy-6-[[(1S,3R,6S,9S,11E,13S,16S,17S,18S,20S,21R,22S)-23-hydroxy-17-[(2R,4R,5S,6S)-5-hydroxy-4-[(2S,4R,5S,6R)-6-hydroxy-5-[(2S,4R,5R,6S)-4-hydroxy-5-methoxy-6-methyloxan-2-yl]oxy-4-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-4-(hydroxymethyl)-3,8,12,18,20,22-hexamethyl-25,27-dioxo-26-oxapentacyclo[22.2.1.01,6.013,22.016,21]heptacosa-4,7,11,14,23-pentaen-9-yl]oxy]-2,4-dimethyloxan-3-yl]carbamate
|
|
| SMILES |
C[C@H]1C[C@@H]([C@@H]([C@@H]2[C@@H]1[C@]3([C@@H](C=C2)/C(=C/C[C@@H](C(=C[C@@H]4C=C([C@@H](C[C@@]45C(=O)C(=C3O)C(=O)O5)C)CO)C)O[C@H]6C[C@]([C@H]([C@H](O6)C)NC(=O)OC)(C)O)/C)C)O[C@H]7C[C@H]([C@H]([C@@H](O7)C)O)O[C@@H]8C[C@H]([C@@H]([C@@H](O8)O)O[C@H]9C[C@H]([C@H]([C@@H](O9)C)OC)O)C)C
|
|
| InChI |
InChI=1S/C61H91NO20/c1-27-14-17-41(77-46-25-59(10,71)53(35(9)76-46)62-58(70)73-13)28(2)19-37-21-36(26-63)32(6)24-61(37)55(67)47(56(68)82-61)54(66)60(11)39(27)16-15-38-48(60)29(3)18-30(4)50(38)79-45-23-42(49(65)33(7)74-45)78-43-20-31(5)51(57(69)81-43)80-44-22-40(64)52(72-12)34(8)75-44/h14-16,19,21,29-35,37-46,48-53,57,63-66,69,71H,17-18,20,22-26H2,1-13H3,(H,62,70)/b27-14+,28-19?,54-47?/t29-,30-,31+,32+,33-,34-,35+,37+,38-,39-,40+,41-,42+,43-,44-,45-,46-,48+,49-,50-,51-,52-,53-,57+,59-,60+,61-/m0/s1
|
|
| InChIKey |
BASUTJPBQPISSG-QZOPSENTSA-N
|
|
| Synonyms |
Lobophorin CR1
|
|
| CAS | NA | |
| PubChem CID | 156581181 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 1158.4 | ALogp: | 4.4 |
| HBD: | 7 | HBA: | 20 |
| Rotatable Bonds: | 12 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 286.0 | Aromatic Rings: | 9 |
| Heavy Atoms: | 82 | QED Weighted: | 0.074 |
| Caco-2 Permeability: | -5.707 | MDCK Permeability: | 0.00058156 |
| Pgp-inhibitor: | 0.996 | Pgp-substrate: | 1 |
| Human Intestinal Absorption (HIA): | 0.538 | 20% Bioavailability (F20%): | 0.002 |
| 30% Bioavailability (F30%): | 0.321 |
| Blood-Brain-Barrier Penetration (BBB): | 0.007 | Plasma Protein Binding (PPB): | 86.92% |
| Volume Distribution (VD): | 0.744 | Fu: | 9.32% |
| CYP1A2-inhibitor: | 0 | CYP1A2-substrate: | 0.903 |
| CYP2C19-inhibitor: | 0.011 | CYP2C19-substrate: | 0.615 |
| CYP2C9-inhibitor: | 0.005 | CYP2C9-substrate: | 0 |
| CYP2D6-inhibitor: | 0 | CYP2D6-substrate: | 0.036 |
| CYP3A4-inhibitor: | 0.913 | CYP3A4-substrate: | 0.92 |
| Clearance (CL): | 6.068 | Half-life (T1/2): | 0.017 |
| hERG Blockers: | 0.509 | Human Hepatotoxicity (H-HT): | 0.903 |
| Drug-inuced Liver Injury (DILI): | 0.99 | AMES Toxicity: | 0.971 |
| Rat Oral Acute Toxicity: | 0.975 | Maximum Recommended Daily Dose: | 0.997 |
| Skin Sensitization: | 0.254 | Carcinogencity: | 0.208 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.005 |
| Respiratory Toxicity: | 0.99 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003727 | ![]() |
0.890 | D03KTD | ![]() |
0.412 | ||
| ENC004223 | ![]() |
0.890 | D06EPF | ![]() |
0.383 | ||
| ENC003877 | ![]() |
0.887 | D0P6IK | ![]() |
0.365 | ||
| ENC004293 | ![]() |
0.842 | D09YHJ | ![]() |
0.361 | ||
| ENC004294 | ![]() |
0.832 | D0SL2V | ![]() |
0.361 | ||
| ENC003236 | ![]() |
0.824 | D09HTS | ![]() |
0.359 | ||
| ENC003730 | ![]() |
0.815 | D0Q6OS | ![]() |
0.347 | ||
| ENC003621 | ![]() |
0.805 | D0L4SD | ![]() |
0.346 | ||
| ENC003639 | ![]() |
0.730 | D0F5OR | ![]() |
0.343 | ||
| ENC003260 | ![]() |
0.588 | D0V3GA | ![]() |
0.339 | ||