|
Name |
[(1S,2R,3E,5R,7S,9E,11S,14S,15R,16S)-16-benzyl-5-hydroxy-5,7,13,14-tetramethyl-6,18-dioxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9,12-trien-2-yl] acetate
|
| Molecular Formula | C30H37NO5 | |
| IUPAC Name* |
[(1S,2R,3E,5R,7S,9E,11S,14S,15R,16S)-16-benzyl-5-hydroxy-5,7,13,14-tetramethyl-6,18-dioxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9,12-trien-2-yl] acetate
|
|
| SMILES |
C[C@H]1C/C=C/[C@H]2C=C([C@H]([C@@H]3[C@@]2([C@@H](/C=C/[C@@](C1=O)(C)O)OC(=O)C)C(=O)N[C@H]3CC4=CC=CC=C4)C)C
|
|
| InChI |
InChI=1S/C30H37NO5/c1-18-10-9-13-23-16-19(2)20(3)26-24(17-22-11-7-6-8-12-22)31-28(34)30(23,26)25(36-21(4)32)14-15-29(5,35)27(18)33/h6-9,11-16,18,20,23-26,35H,10,17H2,1-5H3,(H,31,34)/b13-9+,15-14+/t18-,20+,23-,24-,25+,26-,29+,30+/m0/s1
|
|
| InChIKey |
VFEKKHXLJKMKBO-QTYSQMMNSA-N
|
|
| Synonyms |
Zygosporin G; 25374-69-0
|
|
| CAS | NA | |
| PubChem CID | 156588125 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 491.6 | ALogp: | 3.9 |
| HBD: | 2 | HBA: | 5 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 92.7 | Aromatic Rings: | 4 |
| Heavy Atoms: | 36 | QED Weighted: | 0.477 |
| Caco-2 Permeability: | -5.006 | MDCK Permeability: | 0.00001350 |
| Pgp-inhibitor: | 0.339 | Pgp-substrate: | 0.973 |
| Human Intestinal Absorption (HIA): | 0.197 | 20% Bioavailability (F20%): | 0.283 |
| 30% Bioavailability (F30%): | 0.007 |
| Blood-Brain-Barrier Penetration (BBB): | 0.658 | Plasma Protein Binding (PPB): | 92.87% |
| Volume Distribution (VD): | 1.406 | Fu: | 3.47% |
| CYP1A2-inhibitor: | 0.057 | CYP1A2-substrate: | 0.121 |
| CYP2C19-inhibitor: | 0.666 | CYP2C19-substrate: | 0.468 |
| CYP2C9-inhibitor: | 0.749 | CYP2C9-substrate: | 0.072 |
| CYP2D6-inhibitor: | 0.204 | CYP2D6-substrate: | 0.096 |
| CYP3A4-inhibitor: | 0.952 | CYP3A4-substrate: | 0.445 |
| Clearance (CL): | 4.146 | Half-life (T1/2): | 0.277 |
| hERG Blockers: | 0.104 | Human Hepatotoxicity (H-HT): | 0.631 |
| Drug-inuced Liver Injury (DILI): | 0.719 | AMES Toxicity: | 0.043 |
| Rat Oral Acute Toxicity: | 0.759 | Maximum Recommended Daily Dose: | 0.976 |
| Skin Sensitization: | 0.154 | Carcinogencity: | 0.097 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
| Respiratory Toxicity: | 0.977 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005442 | ![]() |
0.861 | D01TSI | ![]() |
0.283 | ||
| ENC001922 | ![]() |
0.815 | D0V3ZA | ![]() |
0.276 | ||
| ENC005440 | ![]() |
0.800 | D09NNH | ![]() |
0.268 | ||
| ENC004542 | ![]() |
0.800 | D0SP3D | ![]() |
0.268 | ||
| ENC005439 | ![]() |
0.798 | D0W7RJ | ![]() |
0.265 | ||
| ENC004026 | ![]() |
0.770 | D06CWH | ![]() |
0.261 | ||
| ENC005441 | ![]() |
0.735 | D0E9KA | ![]() |
0.257 | ||
| ENC002202 | ![]() |
0.733 | D0R1BD | ![]() |
0.256 | ||
| ENC004463 | ![]() |
0.724 | D0A5LH | ![]() |
0.250 | ||
| ENC004541 | ![]() |
0.636 | D0O5WP | ![]() |
0.249 | ||