|
Name |
Cytochalasin D
|
| Molecular Formula | C30H37NO6 | |
| IUPAC Name* |
[(1R,5R)-16-benzyl-5,12-dihydroxy-5,7,14-trimethyl-13-methylidene-6,18-dioxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9-dien-2-yl] acetate
|
|
| SMILES |
CC1CC=CC2C(C(=C)C(C3[C@@]2(C(C=C[C@@](C1=O)(C)O)OC(=O)C)C(=O)NC3CC4=CC=CC=C4)C)O
|
|
| InChI |
InChI=1S/C30H37NO6/c1-17-10-9-13-22-26(33)19(3)18(2)25-23(16-21-11-7-6-8-12-21)31-28(35)30(22,25)24(37-20(4)32)14-15-29(5,36)27(17)34/h6-9,11-15,17-18,22-26,33,36H,3,10,16H2,1-2,4-5H3,(H,31,35)/t17?,18?,22?,23?,24?,25?,26?,29-,30-/m1/s1
|
|
| InChIKey |
SDZRWUKZFQQKKV-BPYILLIUSA-N
|
|
| Synonyms |
cytochalasin D; Zygosporin A;NSC 209835; 22144-77-0
|
|
| CAS | 22144-77-0 | |
| PubChem CID | 146158182 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 507.6 | ALogp: | 2.7 |
| HBD: | 3 | HBA: | 6 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 113.0 | Aromatic Rings: | 4 |
| Heavy Atoms: | 37 | QED Weighted: | 0.425 |
| Caco-2 Permeability: | -4.942 | MDCK Permeability: | 0.00003880 |
| Pgp-inhibitor: | 0.035 | Pgp-substrate: | 0.031 |
| Human Intestinal Absorption (HIA): | 0.185 | 20% Bioavailability (F20%): | 0.009 |
| 30% Bioavailability (F30%): | 0.002 |
| Blood-Brain-Barrier Penetration (BBB): | 0.651 | Plasma Protein Binding (PPB): | 85.21% |
| Volume Distribution (VD): | 1.683 | Fu: | 17.70% |
| CYP1A2-inhibitor: | 0.016 | CYP1A2-substrate: | 0.094 |
| CYP2C19-inhibitor: | 0.071 | CYP2C19-substrate: | 0.459 |
| CYP2C9-inhibitor: | 0.048 | CYP2C9-substrate: | 0.098 |
| CYP2D6-inhibitor: | 0.01 | CYP2D6-substrate: | 0.094 |
| CYP3A4-inhibitor: | 0.925 | CYP3A4-substrate: | 0.489 |
| Clearance (CL): | 2.984 | Half-life (T1/2): | 0.11 |
| hERG Blockers: | 0.006 | Human Hepatotoxicity (H-HT): | 0.072 |
| Drug-inuced Liver Injury (DILI): | 0.874 | AMES Toxicity: | 0.012 |
| Rat Oral Acute Toxicity: | 0.731 | Maximum Recommended Daily Dose: | 0.409 |
| Skin Sensitization: | 0.016 | Carcinogencity: | 0.155 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.009 |
| Respiratory Toxicity: | 0.524 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004468 | ![]() |
0.818 | D06CWH | ![]() |
0.274 | ||
| ENC003300 | ![]() |
0.802 | D0V3ZA | ![]() |
0.273 | ||
| ENC004463 | ![]() |
0.772 | D0SP3D | ![]() |
0.272 | ||
| ENC004444 | ![]() |
0.770 | D01TSI | ![]() |
0.266 | ||
| ENC005442 | ![]() |
0.765 | D09NNH | ![]() |
0.265 | ||
| ENC002202 | ![]() |
0.765 | D0W7RJ | ![]() |
0.261 | ||
| ENC004341 | ![]() |
0.752 | D0R1BD | ![]() |
0.252 | ||
| ENC006059 | ![]() |
0.752 | D0A5LH | ![]() |
0.247 | ||
| ENC005506 | ![]() |
0.752 | D0TB8C | ![]() |
0.245 | ||
| ENC005175 | ![]() |
0.752 | D0D7KC | ![]() |
0.245 | ||