![]() |
Name |
xylariasin C
|
Molecular Formula | C30H39NO4 | |
IUPAC Name* |
(16-benzyl-6-hydroxy-5,7,13,14-tetramethyl-18-oxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9,12-trien-2-yl)acetate
|
|
SMILES |
CC(=O)OC1C=CC(C)C(O)C(C)CC=CC2C=C(C)C(C)C3C(Cc4ccccc4)NC(=O)C213
|
|
InChI |
InChI=1S/C30H39NO4/c1-18-10-9-13-24-16-20(3)21(4)27-25(17-23-11-7-6-8-12-23)31-29(34)30(24,27)26(35-22(5)32)15-14-19(2)28(18)33/h6-9,11-16,18-19,21,24-28,33H,10,17H2,1-5H3,(H,31,34)/b13-9+,15-14+/t18-,19-,21+,24-,25-,26+,27-,28+,30+/m0/s1
|
|
InChIKey |
JODZJYPJHUCATK-NWKCHZKFSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 477.65 | ALogp: | 4.6 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 75.6 | Aromatic Rings: | 4 |
Heavy Atoms: | 35 | QED Weighted: | 0.47 |
Caco-2 Permeability: | -4.803 | MDCK Permeability: | 0.00003490 |
Pgp-inhibitor: | 0.689 | Pgp-substrate: | 0.051 |
Human Intestinal Absorption (HIA): | 0.11 | 20% Bioavailability (F20%): | 0.027 |
30% Bioavailability (F30%): | 0.026 |
Blood-Brain-Barrier Penetration (BBB): | 0.799 | Plasma Protein Binding (PPB): | 96.36% |
Volume Distribution (VD): | 1.394 | Fu: | 2.38% |
CYP1A2-inhibitor: | 0.032 | CYP1A2-substrate: | 0.126 |
CYP2C19-inhibitor: | 0.248 | CYP2C19-substrate: | 0.616 |
CYP2C9-inhibitor: | 0.229 | CYP2C9-substrate: | 0.116 |
CYP2D6-inhibitor: | 0.089 | CYP2D6-substrate: | 0.438 |
CYP3A4-inhibitor: | 0.854 | CYP3A4-substrate: | 0.644 |
Clearance (CL): | 6.232 | Half-life (T1/2): | 0.029 |
hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.013 |
Drug-inuced Liver Injury (DILI): | 0.44 | AMES Toxicity: | 0.121 |
Rat Oral Acute Toxicity: | 0.423 | Maximum Recommended Daily Dose: | 0.469 |
Skin Sensitization: | 0.015 | Carcinogencity: | 0.021 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
Respiratory Toxicity: | 0.956 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004542 | ![]() |
0.798 | D0FX2Q | ![]() |
0.243 | ||
ENC005439 | ![]() |
0.796 | D0TB8C | ![]() |
0.243 | ||
ENC001922 | ![]() |
0.748 | D01TSI | ![]() |
0.243 | ||
ENC004444 | ![]() |
0.735 | D0G1VX | ![]() |
0.241 | ||
ENC005440 | ![]() |
0.735 | D06CWH | ![]() |
0.241 | ||
ENC003300 | ![]() |
0.647 | D0R1BD | ![]() |
0.240 | ||
ENC004341 | ![]() |
0.644 | D0D4PB | ![]() |
0.237 | ||
ENC006059 | ![]() |
0.644 | D04ITO | ![]() |
0.236 | ||
ENC004745 | ![]() |
0.633 | D09NNH | ![]() |
0.236 | ||
ENC005442 | ![]() |
0.631 | D0OB1J | ![]() |
0.236 |