|
Name |
Diaporthichalasin H
|
| Molecular Formula | C30H39NO5 | |
| IUPAC Name* |
[(1S,2R,3E,5S,7S,9E,11S,14S,15R,16S)-2-hydroxy-16-[(4-hydroxyphenyl)methyl]-5,7,14-trimethyl-18-oxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9,12-trien-13-yl]methyl acetate
|
|
| SMILES |
C[C@H]1C/C=C/[C@H]2C=C([C@H]([C@@H]3[C@@]2([C@@H](/C=C/[C@H](C1)C)O)C(=O)N[C@H]3CC4=CC=C(C=C4)O)C)COC(=O)C
|
|
| InChI |
InChI=1S/C30H39NO5/c1-18-6-5-7-24-16-23(17-36-21(4)32)20(3)28-26(15-22-9-11-25(33)12-10-22)31-29(35)30(24,28)27(34)13-8-19(2)14-18/h5,7-13,16,18-20,24,26-28,33-34H,6,14-15,17H2,1-4H3,(H,31,35)/b7-5+,13-8+/t18-,19+,20+,24-,26-,27+,28-,30+/m0/s1
|
|
| InChIKey |
MXNKDAVEHMJDTC-PULVDKHCSA-N
|
|
| Synonyms |
Diaporthichalasin H
|
|
| CAS | NA | |
| PubChem CID | 156582435 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 493.6 | ALogp: | 4.3 |
| HBD: | 3 | HBA: | 5 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 95.9 | Aromatic Rings: | 4 |
| Heavy Atoms: | 36 | QED Weighted: | 0.411 |
| Caco-2 Permeability: | -5.106 | MDCK Permeability: | 0.00001080 |
| Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.996 |
| Human Intestinal Absorption (HIA): | 0.843 | 20% Bioavailability (F20%): | 0.644 |
| 30% Bioavailability (F30%): | 0.935 |
| Blood-Brain-Barrier Penetration (BBB): | 0.359 | Plasma Protein Binding (PPB): | 89.85% |
| Volume Distribution (VD): | 0.714 | Fu: | 2.52% |
| CYP1A2-inhibitor: | 0.271 | CYP1A2-substrate: | 0.106 |
| CYP2C19-inhibitor: | 0.903 | CYP2C19-substrate: | 0.476 |
| CYP2C9-inhibitor: | 0.883 | CYP2C9-substrate: | 0.873 |
| CYP2D6-inhibitor: | 0.551 | CYP2D6-substrate: | 0.792 |
| CYP3A4-inhibitor: | 0.93 | CYP3A4-substrate: | 0.258 |
| Clearance (CL): | 4.174 | Half-life (T1/2): | 0.337 |
| hERG Blockers: | 0.083 | Human Hepatotoxicity (H-HT): | 0.109 |
| Drug-inuced Liver Injury (DILI): | 0.928 | AMES Toxicity: | 0.152 |
| Rat Oral Acute Toxicity: | 0.739 | Maximum Recommended Daily Dose: | 0.986 |
| Skin Sensitization: | 0.239 | Carcinogencity: | 0.505 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.009 |
| Respiratory Toxicity: | 0.983 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004371 | ![]() |
0.829 | D0S2BV | ![]() |
0.257 | ||
| ENC004119 | ![]() |
0.675 | D06WTZ | ![]() |
0.233 | ||
| ENC004118 | ![]() |
0.566 | D0H0ND | ![]() |
0.230 | ||
| ENC006133 | ![]() |
0.562 | D0I0DL | ![]() |
0.225 | ||
| ENC003718 | ![]() |
0.528 | D06XZW | ![]() |
0.224 | ||
| ENC004368 | ![]() |
0.524 | D0B3QM | ![]() |
0.223 | ||
| ENC005130 | ![]() |
0.524 | D00LFB | ![]() |
0.223 | ||
| ENC005442 | ![]() |
0.507 | D0UA0I | ![]() |
0.222 | ||
| ENC005441 | ![]() |
0.504 | D0D7KC | ![]() |
0.222 | ||
| ENC004745 | ![]() |
0.496 | D0E9KA | ![]() |
0.221 | ||