![]() |
Name |
Protuboxepin J
|
Molecular Formula | C23H25N3O3 | |
IUPAC Name* |
(1R,4R)-4-benzyl-1-[(2S)-butan-2-yl]-1-methoxy-2,4-dihydropyrazino[2,1-b]quinazoline-3,6-dione
|
|
SMILES |
CC[C@H](C)[C@]1(C2=NC3=CC=CC=C3C(=O)N2[C@@H](C(=O)N1)CC4=CC=CC=C4)OC
|
|
InChI |
InChI=1S/C23H25N3O3/c1-4-15(2)23(29-3)22-24-18-13-9-8-12-17(18)21(28)26(22)19(20(27)25-23)14-16-10-6-5-7-11-16/h5-13,15,19H,4,14H2,1-3H3,(H,25,27)/t15-,19+,23+/m0/s1
|
|
InChIKey |
LCJOHDBMLZNVPG-FCORRRHLSA-N
|
|
Synonyms |
Protuboxepin J
|
|
CAS | NA | |
PubChem CID | 156582073 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 391.5 | ALogp: | 3.5 |
HBD: | 1 | HBA: | 4 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 71.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 29 | QED Weighted: | 0.715 |
Caco-2 Permeability: | -4.699 | MDCK Permeability: | 0.00002430 |
Pgp-inhibitor: | 0.982 | Pgp-substrate: | 0.005 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.892 |
30% Bioavailability (F30%): | 0.601 |
Blood-Brain-Barrier Penetration (BBB): | 0.899 | Plasma Protein Binding (PPB): | 91.31% |
Volume Distribution (VD): | 1.341 | Fu: | 5.51% |
CYP1A2-inhibitor: | 0.247 | CYP1A2-substrate: | 0.549 |
CYP2C19-inhibitor: | 0.895 | CYP2C19-substrate: | 0.443 |
CYP2C9-inhibitor: | 0.922 | CYP2C9-substrate: | 0.252 |
CYP2D6-inhibitor: | 0.139 | CYP2D6-substrate: | 0.272 |
CYP3A4-inhibitor: | 0.835 | CYP3A4-substrate: | 0.898 |
Clearance (CL): | 8.898 | Half-life (T1/2): | 0.385 |
hERG Blockers: | 0.029 | Human Hepatotoxicity (H-HT): | 0.572 |
Drug-inuced Liver Injury (DILI): | 0.958 | AMES Toxicity: | 0.04 |
Rat Oral Acute Toxicity: | 0.586 | Maximum Recommended Daily Dose: | 0.792 |
Skin Sensitization: | 0.067 | Carcinogencity: | 0.535 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.01 |
Respiratory Toxicity: | 0.164 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004645 | ![]() |
0.716 | D0QV5T | ![]() |
0.365 | ||
ENC004267 | ![]() |
0.674 | D0B1FE | ![]() |
0.344 | ||
ENC004605 | ![]() |
0.622 | D0T5UL | ![]() |
0.340 | ||
ENC004646 | ![]() |
0.622 | D08FTG | ![]() |
0.337 | ||
ENC004606 | ![]() |
0.622 | D0E3OF | ![]() |
0.336 | ||
ENC004647 | ![]() |
0.622 | D0D4PB | ![]() |
0.333 | ||
ENC002940 | ![]() |
0.606 | D07VHR | ![]() |
0.333 | ||
ENC003272 | ![]() |
0.606 | D03HCZ | ![]() |
0.330 | ||
ENC004609 | ![]() |
0.505 | D0J6WW | ![]() |
0.330 | ||
ENC003764 | ![]() |
0.496 | D0KS6W | ![]() |
0.330 |