|
Name |
Aniquinazoline C
|
| Molecular Formula | C27H31N5O5 | |
| IUPAC Name* |
(1S,4R)-1-hydroxy-4-[2-hydroxy-2-[(2R,4S)-5-oxo-1-phenyl-4-propan-2-ylimidazolidin-2-yl]propyl]-1-methyl-2,4-dihydropyrazino[2,1-b]quinazoline-3,6-dione
|
|
| SMILES |
CC(C)[C@H]1C(=O)N([C@@H](N1)C(C)(C[C@@H]2C(=O)N[C@@](C3=NC4=CC=CC=C4C(=O)N23)(C)O)O)C5=CC=CC=C5
|
|
| InChI |
InChI=1S/C27H31N5O5/c1-15(2)20-23(35)31(16-10-6-5-7-11-16)24(29-20)26(3,36)14-19-21(33)30-27(4,37)25-28-18-13-9-8-12-17(18)22(34)32(19)25/h5-13,15,19-20,24,29,36-37H,14H2,1-4H3,(H,30,33)/t19-,20+,24-,26?,27+/m1/s1
|
|
| InChIKey |
ALKYEXCSBFPRPV-ALXWUKCCSA-N
|
|
| Synonyms |
Aniquinazoline C
|
|
| CAS | NA | |
| PubChem CID | 139587840 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 505.6 | ALogp: | 1.6 |
| HBD: | 4 | HBA: | 7 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 135.0 | Aromatic Rings: | 5 |
| Heavy Atoms: | 37 | QED Weighted: | 0.415 |
| Caco-2 Permeability: | -5.442 | MDCK Permeability: | 0.00001910 |
| Pgp-inhibitor: | 0.922 | Pgp-substrate: | 0.138 |
| Human Intestinal Absorption (HIA): | 0.041 | 20% Bioavailability (F20%): | 0.028 |
| 30% Bioavailability (F30%): | 0.018 |
| Blood-Brain-Barrier Penetration (BBB): | 0.065 | Plasma Protein Binding (PPB): | 68.49% |
| Volume Distribution (VD): | 0.692 | Fu: | 33.71% |
| CYP1A2-inhibitor: | 0.026 | CYP1A2-substrate: | 0.247 |
| CYP2C19-inhibitor: | 0.059 | CYP2C19-substrate: | 0.726 |
| CYP2C9-inhibitor: | 0.248 | CYP2C9-substrate: | 0.259 |
| CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.112 |
| CYP3A4-inhibitor: | 0.527 | CYP3A4-substrate: | 0.922 |
| Clearance (CL): | 4.364 | Half-life (T1/2): | 0.329 |
| hERG Blockers: | 0.005 | Human Hepatotoxicity (H-HT): | 0.949 |
| Drug-inuced Liver Injury (DILI): | 0.989 | AMES Toxicity: | 0.006 |
| Rat Oral Acute Toxicity: | 0.015 | Maximum Recommended Daily Dose: | 0.879 |
| Skin Sensitization: | 0.087 | Carcinogencity: | 0.038 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.006 |
| Respiratory Toxicity: | 0.703 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003666 | ![]() |
0.788 | D0B1FE | ![]() |
0.319 | ||
| ENC003601 | ![]() |
0.637 | D07VHR | ![]() |
0.313 | ||
| ENC002409 | ![]() |
0.589 | D0QV5T | ![]() |
0.296 | ||
| ENC004645 | ![]() |
0.525 | D0E3OF | ![]() |
0.295 | ||
| ENC004348 | ![]() |
0.496 | D0J5YC | ![]() |
0.293 | ||
| ENC002127 | ![]() |
0.466 | D0J6WW | ![]() |
0.288 | ||
| ENC001948 | ![]() |
0.466 | D06ZPS | ![]() |
0.288 | ||
| ENC004647 | ![]() |
0.455 | D0E4DW | ![]() |
0.287 | ||
| ENC004267 | ![]() |
0.455 | D03DEI | ![]() |
0.283 | ||
| ENC002940 | ![]() |
0.449 | D0J5VR | ![]() |
0.280 | ||