|
Name |
Brevianamide M
|
| Molecular Formula | C18H15N3O3 | |
| IUPAC Name* |
(1S,4S)-4-benzyl-1-hydroxy-2,4-dihydro-1H-pyrazino[2,1-b]quinazoline-3,6-dione
|
|
| SMILES |
C1=CC=C(C=C1)C[C@H]2C(=O)N[C@H](C3=NC4=CC=CC=C4C(=O)N23)O
|
|
| InChI |
InChI=1S/C18H15N3O3/c22-16-14(10-11-6-2-1-3-7-11)21-15(17(23)20-16)19-13-9-5-4-8-12(13)18(21)24/h1-9,14,17,23H,10H2,(H,20,22)/t14-,17-/m0/s1
|
|
| InChIKey |
QUNZIYMNPBSOEB-YOEHRIQHSA-N
|
|
| Synonyms |
Brevianamide M
|
|
| CAS | NA | |
| PubChem CID | 102482440 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 321.3 | ALogp: | 1.5 |
| HBD: | 2 | HBA: | 4 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 82.0 | Aromatic Rings: | 4 |
| Heavy Atoms: | 24 | QED Weighted: | 0.753 |
| Caco-2 Permeability: | -5.03 | MDCK Permeability: | 0.00001560 |
| Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.003 |
| Human Intestinal Absorption (HIA): | 0.474 | 20% Bioavailability (F20%): | 0.981 |
| 30% Bioavailability (F30%): | 0.582 |
| Blood-Brain-Barrier Penetration (BBB): | 0.848 | Plasma Protein Binding (PPB): | 85.52% |
| Volume Distribution (VD): | 1.427 | Fu: | 20.62% |
| CYP1A2-inhibitor: | 0.113 | CYP1A2-substrate: | 0.088 |
| CYP2C19-inhibitor: | 0.302 | CYP2C19-substrate: | 0.288 |
| CYP2C9-inhibitor: | 0.451 | CYP2C9-substrate: | 0.248 |
| CYP2D6-inhibitor: | 0.036 | CYP2D6-substrate: | 0.17 |
| CYP3A4-inhibitor: | 0.191 | CYP3A4-substrate: | 0.658 |
| Clearance (CL): | 6.301 | Half-life (T1/2): | 0.479 |
| hERG Blockers: | 0.016 | Human Hepatotoxicity (H-HT): | 0.408 |
| Drug-inuced Liver Injury (DILI): | 0.911 | AMES Toxicity: | 0.167 |
| Rat Oral Acute Toxicity: | 0.045 | Maximum Recommended Daily Dose: | 0.373 |
| Skin Sensitization: | 0.064 | Carcinogencity: | 0.304 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.02 |
| Respiratory Toxicity: | 0.399 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004267 | ![]() |
0.759 | D0B1FE | ![]() |
0.398 | ||
| ENC004931 | ![]() |
0.750 | D08FTG | ![]() |
0.388 | ||
| ENC002940 | ![]() |
0.704 | D0QV5T | ![]() |
0.372 | ||
| ENC004646 | ![]() |
0.640 | D0E3OF | ![]() |
0.367 | ||
| ENC004647 | ![]() |
0.640 | D0G1VX | ![]() |
0.349 | ||
| ENC004606 | ![]() |
0.640 | D0E4DW | ![]() |
0.348 | ||
| ENC004605 | ![]() |
0.640 | D09LDR | ![]() |
0.340 | ||
| ENC004645 | ![]() |
0.630 | D07VHR | ![]() |
0.337 | ||
| ENC001979 | ![]() |
0.615 | D0J5YC | ![]() |
0.337 | ||
| ENC005478 | ![]() |
0.615 | D0M9DC | ![]() |
0.330 | ||