|
Name |
Sporochartine F
|
| Molecular Formula | C27H40O9 | |
| IUPAC Name* |
methyl (2S)-2-[[(3S,3aS,6R,6aR)-6-hexyl-2,4-dioxo-3,3a,6,6a-tetrahydrofuro[2,3-c]furan-3-yl]methyl]-2-[(1R)-1-hydroxyheptyl]-4-methyl-5-oxofuran-3-carboxylate
|
|
| SMILES |
CCCCCC[C@@H]1[C@H]2[C@H]([C@@H](C(=O)O2)C[C@]3(C(=C(C(=O)O3)C)C(=O)OC)[C@@H](CCCCCC)O)C(=O)O1
|
|
| InChI |
InChI=1S/C27H40O9/c1-5-7-9-11-13-18-22-20(25(31)34-18)17(24(30)35-22)15-27(19(28)14-12-10-8-6-2)21(26(32)33-4)16(3)23(29)36-27/h17-20,22,28H,5-15H2,1-4H3/t17-,18+,19+,20-,22-,27+/m0/s1
|
|
| InChIKey |
CPYDOXWTPKFFRN-KYZFODTRSA-N
|
|
| Synonyms |
Sporochartine F
|
|
| CAS | NA | |
| PubChem CID | 146682713 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 508.6 | ALogp: | 4.9 |
| HBD: | 1 | HBA: | 9 |
| Rotatable Bonds: | 15 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 125.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 36 | QED Weighted: | 0.208 |
| Caco-2 Permeability: | -5.182 | MDCK Permeability: | 0.00004400 |
| Pgp-inhibitor: | 0.578 | Pgp-substrate: | 0.993 |
| Human Intestinal Absorption (HIA): | 0.012 | 20% Bioavailability (F20%): | 0.035 |
| 30% Bioavailability (F30%): | 0.516 |
| Blood-Brain-Barrier Penetration (BBB): | 0.132 | Plasma Protein Binding (PPB): | 98.62% |
| Volume Distribution (VD): | 2.391 | Fu: | 3.63% |
| CYP1A2-inhibitor: | 0.092 | CYP1A2-substrate: | 0.764 |
| CYP2C19-inhibitor: | 0.754 | CYP2C19-substrate: | 0.813 |
| CYP2C9-inhibitor: | 0.931 | CYP2C9-substrate: | 0.792 |
| CYP2D6-inhibitor: | 0.335 | CYP2D6-substrate: | 0.093 |
| CYP3A4-inhibitor: | 0.756 | CYP3A4-substrate: | 0.156 |
| Clearance (CL): | 6.005 | Half-life (T1/2): | 0.221 |
| hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.615 |
| Drug-inuced Liver Injury (DILI): | 0.521 | AMES Toxicity: | 0.025 |
| Rat Oral Acute Toxicity: | 0.888 | Maximum Recommended Daily Dose: | 0.945 |
| Skin Sensitization: | 0.492 | Carcinogencity: | 0.192 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.013 |
| Respiratory Toxicity: | 0.954 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003631 | ![]() |
0.345 | D0T9TJ | ![]() |
0.368 | ||
| ENC002397 | ![]() |
0.339 | D0I4DQ | ![]() |
0.313 | ||
| ENC001502 | ![]() |
0.327 | D09ANG | ![]() |
0.291 | ||
| ENC002551 | ![]() |
0.320 | D0MM8N | ![]() |
0.269 | ||
| ENC000972 | ![]() |
0.319 | D0XN8C | ![]() |
0.264 | ||
| ENC001313 | ![]() |
0.307 | D0H2YX | ![]() |
0.255 | ||
| ENC003058 | ![]() |
0.306 | D03ZJE | ![]() |
0.254 | ||
| ENC000483 | ![]() |
0.306 | D00CTS | ![]() |
0.254 | ||
| ENC001235 | ![]() |
0.306 | D0ZI4H | ![]() |
0.254 | ||
| ENC001377 | ![]() |
0.303 | D00MLW | ![]() |
0.253 | ||