![]() |
Name |
Sinopestalotiollide D
|
Molecular Formula | C22H24O7 | |
IUPAC Name* |
6-hydroxy-2-[(E)-4-hydroxy-3-methoxy-3-methylbut-1-enyl]-1-methoxy-8-methyl-10H-benzo[b][1,5]benzodioxocin-12-one
|
|
SMILES |
CC1=CC2=C(C(=C1)O)OC3=C(C(=C(C=C3)/C=C/C(C)(CO)OC)OC)C(=O)OC2
|
|
InChI |
InChI=1S/C22H24O7/c1-13-9-15-11-28-21(25)18-17(29-19(15)16(24)10-13)6-5-14(20(18)26-3)7-8-22(2,12-23)27-4/h5-10,23-24H,11-12H2,1-4H3/b8-7+
|
|
InChIKey |
SDYUGOSPMGYUOF-BQYQJAHWSA-N
|
|
Synonyms |
Sinopestalotiollide D; CHEMBL4203098
|
|
CAS | NA | |
PubChem CID | 145978683 | |
ChEMBL ID | CHEMBL4203098 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 400.4 | ALogp: | 2.7 |
HBD: | 2 | HBA: | 7 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 94.4 | Aromatic Rings: | 3 |
Heavy Atoms: | 29 | QED Weighted: | 0.723 |
Caco-2 Permeability: | -4.796 | MDCK Permeability: | 0.00001450 |
Pgp-inhibitor: | 0.05 | Pgp-substrate: | 0.376 |
Human Intestinal Absorption (HIA): | 0.039 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.008 |
Blood-Brain-Barrier Penetration (BBB): | 0.191 | Plasma Protein Binding (PPB): | 97.02% |
Volume Distribution (VD): | 0.426 | Fu: | 4.73% |
CYP1A2-inhibitor: | 0.95 | CYP1A2-substrate: | 0.926 |
CYP2C19-inhibitor: | 0.561 | CYP2C19-substrate: | 0.607 |
CYP2C9-inhibitor: | 0.561 | CYP2C9-substrate: | 0.815 |
CYP2D6-inhibitor: | 0.623 | CYP2D6-substrate: | 0.576 |
CYP3A4-inhibitor: | 0.874 | CYP3A4-substrate: | 0.81 |
Clearance (CL): | 10.278 | Half-life (T1/2): | 0.721 |
hERG Blockers: | 0.029 | Human Hepatotoxicity (H-HT): | 0.047 |
Drug-inuced Liver Injury (DILI): | 0.4 | AMES Toxicity: | 0.739 |
Rat Oral Acute Toxicity: | 0.623 | Maximum Recommended Daily Dose: | 0.469 |
Skin Sensitization: | 0.656 | Carcinogencity: | 0.925 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.458 |
Respiratory Toxicity: | 0.266 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001927 | ![]() |
0.826 | D0L1JW | ![]() |
0.301 | ||
ENC006147 | ![]() |
0.812 | D06GCK | ![]() |
0.296 | ||
ENC004018 | ![]() |
0.638 | D04TDQ | ![]() |
0.289 | ||
ENC004016 | ![]() |
0.621 | D04UTT | ![]() |
0.274 | ||
ENC001921 | ![]() |
0.621 | D02LZB | ![]() |
0.270 | ||
ENC000877 | ![]() |
0.621 | D07MGA | ![]() |
0.270 | ||
ENC004017 | ![]() |
0.604 | D0G4KG | ![]() |
0.267 | ||
ENC006148 | ![]() |
0.576 | D0F7CS | ![]() |
0.266 | ||
ENC002740 | ![]() |
0.576 | D0W8WB | ![]() |
0.264 | ||
ENC002739 | ![]() |
0.576 | D09DHY | ![]() |
0.260 |