NPs Basic Information
|
Name |
Sinopestalotiollide C
|
| Molecular Formula | C21H24O6 | |
| IUPAC Name* |
6-hydroxy-2-(1-hydroxy-3-methylbutan-2-yl)-1-methoxy-8-methyl-10H-benzo[b][1,5]benzodioxocin-12-one
|
|
| SMILES |
CC1=CC2=C(C(=C1)O)OC3=C(C(=C(C=C3)C(CO)C(C)C)OC)C(=O)OC2
|
|
| InChI |
InChI=1S/C21H24O6/c1-11(2)15(9-22)14-5-6-17-18(20(14)25-4)21(24)26-10-13-7-12(3)8-16(23)19(13)27-17/h5-8,11,15,22-23H,9-10H2,1-4H3
|
|
| InChIKey |
IYUVXRIYTHLTLH-UHFFFAOYSA-N
|
|
| Synonyms |
Sinopestalotiollide C; CHEMBL4206208
|
|
| CAS | NA | |
| PubChem CID | 145977134 | |
| ChEMBL ID | CHEMBL4206208 |
*Note: the IUPAC Name was collected from PubChem.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 372.4 | ALogp: | 3.6 |
| HBD: | 2 | HBA: | 6 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 85.2 | Aromatic Rings: | 3 |
| Heavy Atoms: | 27 | QED Weighted: | 0.766 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -4.833 | MDCK Permeability: | 0.00001530 |
| Pgp-inhibitor: | 0.018 | Pgp-substrate: | 0.006 |
| Human Intestinal Absorption (HIA): | 0.058 | 20% Bioavailability (F20%): | 0.01 |
| 30% Bioavailability (F30%): | 0.005 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.08 | Plasma Protein Binding (PPB): | 98.18% |
| Volume Distribution (VD): | 0.659 | Fu: | 2.32% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.642 | CYP1A2-substrate: | 0.846 |
| CYP2C19-inhibitor: | 0.611 | CYP2C19-substrate: | 0.635 |
| CYP2C9-inhibitor: | 0.598 | CYP2C9-substrate: | 0.851 |
| CYP2D6-inhibitor: | 0.398 | CYP2D6-substrate: | 0.616 |
| CYP3A4-inhibitor: | 0.424 | CYP3A4-substrate: | 0.722 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 11.65 | Half-life (T1/2): | 0.474 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.029 | Human Hepatotoxicity (H-HT): | 0.024 |
| Drug-inuced Liver Injury (DILI): | 0.411 | AMES Toxicity: | 0.264 |
| Rat Oral Acute Toxicity: | 0.829 | Maximum Recommended Daily Dose: | 0.684 |
| Skin Sensitization: | 0.417 | Carcinogencity: | 0.852 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.18 |
| Respiratory Toxicity: | 0.524 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001921 |  |
0.805 | D0L1JW |  |
0.294 | ||
| ENC000877 |  |
0.805 | D06GCK |  |
0.288 | ||
| ENC004016 |  |
0.762 | D04UTT |  |
0.288 | ||
| ENC002005 |  |
0.714 | D06GIP |  |
0.288 | ||
| ENC006148 |  |
0.705 | D07MGA |  |
0.286 | ||
| ENC002740 |  |
0.705 | D0QD1G |  |
0.285 | ||
| ENC002739 |  |
0.705 | D04TDQ |  |
0.282 | ||
| ENC004017 |  |
0.663 | D02LZB |  |
0.263 | ||
| ENC006147 |  |
0.644 | D0Z1WA |  |
0.260 | ||
| ENC004019 |  |
0.638 | D0F7CS |  |
0.258 | ||