![]() |
Name |
Sinopestalotiollide A
|
Molecular Formula | C21H22O6 | |
IUPAC Name* |
6-hydroxy-2-(1-hydroxy-3-methylbut-3-en-2-yl)-1-methoxy-8-methyl-10H-benzo[b][1,5]benzodioxocin-12-one
|
|
SMILES |
CC1=CC2=C(C(=C1)O)OC3=C(C(=C(C=C3)C(CO)C(=C)C)OC)C(=O)OC2
|
|
InChI |
InChI=1S/C21H22O6/c1-11(2)15(9-22)14-5-6-17-18(20(14)25-4)21(24)26-10-13-7-12(3)8-16(23)19(13)27-17/h5-8,15,22-23H,1,9-10H2,2-4H3
|
|
InChIKey |
VGRRRJVTFBDYHR-UHFFFAOYSA-N
|
|
Synonyms |
Sinopestalotiollide A; CHEMBL4208581
|
|
CAS | NA | |
PubChem CID | 145966796 | |
ChEMBL ID | CHEMBL4208581 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 370.4 | ALogp: | 3.7 |
HBD: | 2 | HBA: | 6 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 85.2 | Aromatic Rings: | 3 |
Heavy Atoms: | 27 | QED Weighted: | 0.609 |
Caco-2 Permeability: | -4.787 | MDCK Permeability: | 0.00001320 |
Pgp-inhibitor: | 0.071 | Pgp-substrate: | 0.008 |
Human Intestinal Absorption (HIA): | 0.028 | 20% Bioavailability (F20%): | 0.014 |
30% Bioavailability (F30%): | 0.002 |
Blood-Brain-Barrier Penetration (BBB): | 0.026 | Plasma Protein Binding (PPB): | 94.83% |
Volume Distribution (VD): | 0.806 | Fu: | 2.70% |
CYP1A2-inhibitor: | 0.822 | CYP1A2-substrate: | 0.863 |
CYP2C19-inhibitor: | 0.503 | CYP2C19-substrate: | 0.656 |
CYP2C9-inhibitor: | 0.46 | CYP2C9-substrate: | 0.807 |
CYP2D6-inhibitor: | 0.417 | CYP2D6-substrate: | 0.751 |
CYP3A4-inhibitor: | 0.529 | CYP3A4-substrate: | 0.669 |
Clearance (CL): | 11.217 | Half-life (T1/2): | 0.447 |
hERG Blockers: | 0.031 | Human Hepatotoxicity (H-HT): | 0.046 |
Drug-inuced Liver Injury (DILI): | 0.364 | AMES Toxicity: | 0.176 |
Rat Oral Acute Toxicity: | 0.876 | Maximum Recommended Daily Dose: | 0.946 |
Skin Sensitization: | 0.218 | Carcinogencity: | 0.872 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.206 |
Respiratory Toxicity: | 0.628 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002739 | ![]() |
0.786 | D0F7CS | ![]() |
0.300 | ||
ENC002740 | ![]() |
0.786 | D0L1JW | ![]() |
0.294 | ||
ENC006148 | ![]() |
0.786 | D06GCK | ![]() |
0.288 | ||
ENC004017 | ![]() |
0.762 | D04UTT | ![]() |
0.288 | ||
ENC004018 | ![]() |
0.762 | D07MGA | ![]() |
0.286 | ||
ENC001921 | ![]() |
0.721 | D04TDQ | ![]() |
0.272 | ||
ENC000877 | ![]() |
0.721 | D09DHY | ![]() |
0.262 | ||
ENC002005 | ![]() |
0.677 | D0G4KG | ![]() |
0.257 | ||
ENC006147 | ![]() |
0.626 | D0W8WB | ![]() |
0.256 | ||
ENC004019 | ![]() |
0.621 | D06GIP | ![]() |
0.256 |