![]() |
Name |
Nectriapyrone
|
Molecular Formula | C11H14O3 | |
IUPAC Name* |
6-[(E)-but-2-en-2-yl]-4-methoxy-3-methylpyran-2-one
|
|
SMILES |
C/C=C(\C)/C1=CC(=C(C(=O)O1)C)OC
|
|
InChI |
InChI=1S/C11H14O3/c1-5-7(2)9-6-10(13-4)8(3)11(12)14-9/h5-6H,1-4H3/b7-5+
|
|
InChIKey |
NRLCQITWKJENAT-FNORWQNLSA-N
|
|
Synonyms |
NECTRIAPYRONE; 57685-79-7; 6-[(E)-but-2-en-2-yl]-4-methoxy-3-methylpyran-2-one; 6-((E)-But-2-en-2-yl)-4-methoxy-3-methylpyran-2-one; NSC263671; NRLCQITWKJENAT-FNORWQNLSA-; CHEBI:142639; NSC 263671; NSC-263671; 6-[(2E)-but-2-en-2-yl]-4-methoxy-3-methyl-2H-pyran-2-one
|
|
CAS | 57685-79-7 | |
PubChem CID | 5358550 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 194.23 | ALogp: | 2.5 |
HBD: | 0 | HBA: | 3 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 35.5 | Aromatic Rings: | 1 |
Heavy Atoms: | 14 | QED Weighted: | 0.726 |
Caco-2 Permeability: | -4.571 | MDCK Permeability: | 0.00001700 |
Pgp-inhibitor: | 0.018 | Pgp-substrate: | 0.014 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.009 |
30% Bioavailability (F30%): | 0.912 |
Blood-Brain-Barrier Penetration (BBB): | 0.085 | Plasma Protein Binding (PPB): | 91.75% |
Volume Distribution (VD): | 1.206 | Fu: | 16.45% |
CYP1A2-inhibitor: | 0.969 | CYP1A2-substrate: | 0.957 |
CYP2C19-inhibitor: | 0.877 | CYP2C19-substrate: | 0.822 |
CYP2C9-inhibitor: | 0.372 | CYP2C9-substrate: | 0.823 |
CYP2D6-inhibitor: | 0.027 | CYP2D6-substrate: | 0.853 |
CYP3A4-inhibitor: | 0.067 | CYP3A4-substrate: | 0.326 |
Clearance (CL): | 4.751 | Half-life (T1/2): | 0.501 |
hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.304 |
Drug-inuced Liver Injury (DILI): | 0.622 | AMES Toxicity: | 0.015 |
Rat Oral Acute Toxicity: | 0.067 | Maximum Recommended Daily Dose: | 0.054 |
Skin Sensitization: | 0.242 | Carcinogencity: | 0.344 |
Eye Corrosion: | 0.673 | Eye Irritation: | 0.939 |
Respiratory Toxicity: | 0.081 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003181 | ![]() |
0.745 | D05QDC | ![]() |
0.278 | ||
ENC002477 | ![]() |
0.717 | D0B1IP | ![]() |
0.259 | ||
ENC003510 | ![]() |
0.711 | D0E9CD | ![]() |
0.241 | ||
ENC003261 | ![]() |
0.681 | D0G4KG | ![]() |
0.233 | ||
ENC003971 | ![]() |
0.674 | D0L5FY | ![]() |
0.218 | ||
ENC005947 | ![]() |
0.635 | D0FA2O | ![]() |
0.217 | ||
ENC004632 | ![]() |
0.635 | D06REO | ![]() |
0.215 | ||
ENC004631 | ![]() |
0.635 | D0C1SF | ![]() |
0.214 | ||
ENC004630 | ![]() |
0.635 | D0O6KE | ![]() |
0.213 | ||
ENC004634 | ![]() |
0.556 | D08VYV | ![]() |
0.213 |