![]() |
Name |
nectriapyrone D
|
Molecular Formula | C11H14O4 | |
IUPAC Name* |
6-[(E)-4-hydroxybut-2-en-2-yl]-4-methoxy-3-methylpyran-2-one
|
|
SMILES |
CC1=C(C=C(OC1=O)/C(=C/CO)/C)OC
|
|
InChI |
InChI=1S/C11H14O4/c1-7(4-5-12)9-6-10(14-3)8(2)11(13)15-9/h4,6,12H,5H2,1-3H3/b7-4+
|
|
InChIKey |
DDLZRFCVVWLJQN-QPJJXVBHSA-N
|
|
Synonyms |
nectriapyrone D; gulypyrone B; nectriapyrone D; CHEBI:142799; 6-[(1E)-3-hydroxy-1-methylpropenyl]-4-methoxy-3-methylpyran-2-one; 6-[(2E)-4-hydroxybut-2-en-2-yl]-4-methoxy-3-methyl-2H-pyran-2-one
|
|
CAS | NA | |
PubChem CID | 135563708 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 210.23 | ALogp: | 1.2 |
HBD: | 1 | HBA: | 4 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 55.8 | Aromatic Rings: | 1 |
Heavy Atoms: | 15 | QED Weighted: | 0.827 |
Caco-2 Permeability: | -4.652 | MDCK Permeability: | 0.00004560 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.054 |
Human Intestinal Absorption (HIA): | 0.011 | 20% Bioavailability (F20%): | 0.015 |
30% Bioavailability (F30%): | 0.931 |
Blood-Brain-Barrier Penetration (BBB): | 0.21 | Plasma Protein Binding (PPB): | 55.14% |
Volume Distribution (VD): | 0.826 | Fu: | 56.71% |
CYP1A2-inhibitor: | 0.884 | CYP1A2-substrate: | 0.875 |
CYP2C19-inhibitor: | 0.23 | CYP2C19-substrate: | 0.615 |
CYP2C9-inhibitor: | 0.087 | CYP2C9-substrate: | 0.599 |
CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.587 |
CYP3A4-inhibitor: | 0.023 | CYP3A4-substrate: | 0.29 |
Clearance (CL): | 7.322 | Half-life (T1/2): | 0.826 |
hERG Blockers: | 0.006 | Human Hepatotoxicity (H-HT): | 0.411 |
Drug-inuced Liver Injury (DILI): | 0.556 | AMES Toxicity: | 0.015 |
Rat Oral Acute Toxicity: | 0.075 | Maximum Recommended Daily Dose: | 0.101 |
Skin Sensitization: | 0.27 | Carcinogencity: | 0.732 |
Eye Corrosion: | 0.251 | Eye Irritation: | 0.891 |
Respiratory Toxicity: | 0.069 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001650 | ![]() |
0.711 | D05QDC | ![]() |
0.268 | ||
ENC003261 | ![]() |
0.673 | D0E9CD | ![]() |
0.250 | ||
ENC002477 | ![]() |
0.673 | D0B1IP | ![]() |
0.250 | ||
ENC004630 | ![]() |
0.660 | D06REO | ![]() |
0.238 | ||
ENC004632 | ![]() |
0.660 | D0L5FY | ![]() |
0.225 | ||
ENC005947 | ![]() |
0.660 | D0G4KG | ![]() |
0.224 | ||
ENC004631 | ![]() |
0.660 | D08VYV | ![]() |
0.221 | ||
ENC003181 | ![]() |
0.604 | D02XJY | ![]() |
0.219 | ||
ENC003971 | ![]() |
0.600 | D0U5CE | ![]() |
0.217 | ||
ENC002656 | ![]() |
0.560 | D03LGG | ![]() |
0.217 |