|
Name |
Pyrrospirone E
|
| Molecular Formula | C32H41NO5 | |
| IUPAC Name* |
(1S,3R,4S,7S,8S,10R,12S,13R,14S,21R,25R,26S)-3,21-dihydroxy-4,6,8,10,12-pentamethyl-15-oxa-22-azaheptacyclo[12.9.3.216,19.11,21.04,25.07,26.08,13]nonacosa-5,16,18,28-tetraene-23,24-dione
|
|
| SMILES |
C[C@@H]1C[C@@H]([C@H]2[C@@H]3[C@H]4[C@H]([C@@]2(C1)C)C(=C[C@]5([C@@H]4C(=O)[C@]6(C[C@H]5O)C[C@](CC7=CC=C(O3)C=C7)(NC6=O)O)C)C)C
|
|
| InChI |
InChI=1S/C32H41NO5/c1-16-10-17(2)24-26-22-23(30(24,5)11-16)18(3)12-29(4)21(34)14-31(27(35)25(22)29)15-32(37,33-28(31)36)13-19-6-8-20(38-26)9-7-19/h6-9,12,16-17,21-26,34,37H,10-11,13-15H2,1-5H3,(H,33,36)/t16-,17+,21-,22+,23-,24+,25+,26+,29-,30+,31+,32-/m1/s1
|
|
| InChIKey |
OZCVEXIHCIYUCZ-LVFIZYTASA-N
|
|
| Synonyms |
Pyrrospirone E; CHEMBL4798529
|
|
| CAS | NA | |
| PubChem CID | 139590337 | |
| ChEMBL ID | CHEMBL4798529 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 519.7 | ALogp: | 4.6 |
| HBD: | 3 | HBA: | 5 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 95.9 | Aromatic Rings: | 8 |
| Heavy Atoms: | 38 | QED Weighted: | 0.342 |
| Caco-2 Permeability: | -5.368 | MDCK Permeability: | 0.00000916 |
| Pgp-inhibitor: | 0.365 | Pgp-substrate: | 0.998 |
| Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.029 |
| 30% Bioavailability (F30%): | 0.828 |
| Blood-Brain-Barrier Penetration (BBB): | 0.884 | Plasma Protein Binding (PPB): | 87.58% |
| Volume Distribution (VD): | 1.636 | Fu: | 8.95% |
| CYP1A2-inhibitor: | 0.034 | CYP1A2-substrate: | 0.831 |
| CYP2C19-inhibitor: | 0.64 | CYP2C19-substrate: | 0.853 |
| CYP2C9-inhibitor: | 0.337 | CYP2C9-substrate: | 0.077 |
| CYP2D6-inhibitor: | 0.066 | CYP2D6-substrate: | 0.059 |
| CYP3A4-inhibitor: | 0.983 | CYP3A4-substrate: | 0.874 |
| Clearance (CL): | 13.999 | Half-life (T1/2): | 0.218 |
| hERG Blockers: | 0.186 | Human Hepatotoxicity (H-HT): | 0.585 |
| Drug-inuced Liver Injury (DILI): | 0.488 | AMES Toxicity: | 0.028 |
| Rat Oral Acute Toxicity: | 0.912 | Maximum Recommended Daily Dose: | 0.969 |
| Skin Sensitization: | 0.039 | Carcinogencity: | 0.178 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
| Respiratory Toxicity: | 0.968 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004852 | ![]() |
0.685 | D0W2EK | ![]() |
0.259 | ||
| ENC004853 | ![]() |
0.683 | D0E9KA | ![]() |
0.238 | ||
| ENC003989 | ![]() |
0.654 | D0P0HT | ![]() |
0.238 | ||
| ENC003349 | ![]() |
0.602 | D0CZ1Q | ![]() |
0.236 | ||
| ENC003137 | ![]() |
0.565 | D0F1EX | ![]() |
0.233 | ||
| ENC003503 | ![]() |
0.556 | D00GOS | ![]() |
0.233 | ||
| ENC005320 | ![]() |
0.552 | D0I5DS | ![]() |
0.228 | ||
| ENC005766 | ![]() |
0.545 | D0D2TN | ![]() |
0.228 | ||
| ENC003606 | ![]() |
0.459 | D08PIQ | ![]() |
0.228 | ||
| ENC005366 | ![]() |
0.459 | D04SFH | ![]() |
0.227 | ||