|
Name |
(3S,4R,5S,7R,9S,10S,13S,14R,19R,27R)-13-ethenyl-19-hydroxy-5,7,9,11-tetramethyl-2-oxa-18-azahexacyclo[19.2.2.13,10.116,19.04,9.014,27]heptacosa-1(24),11,16(26),21(25),22-pentaene-15,17-dione
|
| Molecular Formula | C31H37NO4 | |
| IUPAC Name* |
(3S,4R,5S,7R,9S,10S,13S,14R,19R,27R)-13-ethenyl-19-hydroxy-5,7,9,11-tetramethyl-2-oxa-18-azahexacyclo[19.2.2.13,10.116,19.04,9.014,27]heptacosa-1(24),11,16(26),21(25),22-pentaene-15,17-dione
|
|
| SMILES |
C[C@@H]1C[C@@H]([C@H]2[C@@H]3[C@H]4[C@@H]([C@H](C=C([C@H]4[C@@]2(C1)C)C)C=C)C(=O)C5=C[C@](CC6=CC=C(O3)C=C6)(NC5=O)O)C
|
|
| InChI |
InChI=1S/C31H37NO4/c1-6-20-12-18(4)25-24-23(20)27(33)22-15-31(35,32-29(22)34)14-19-7-9-21(10-8-19)36-28(24)26-17(3)11-16(2)13-30(25,26)5/h6-10,12,15-17,20,23-26,28,35H,1,11,13-14H2,2-5H3,(H,32,34)/t16-,17+,20+,23-,24+,25-,26+,28+,30+,31-/m1/s1
|
|
| InChIKey |
KXMGXXHZDLJDBH-PVSLUVOTSA-N
|
|
| Synonyms |
Pyrrocidine A
|
|
| CAS | NA | |
| PubChem CID | 101159381 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 487.6 | ALogp: | 5.5 |
| HBD: | 2 | HBA: | 4 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 75.6 | Aromatic Rings: | 7 |
| Heavy Atoms: | 36 | QED Weighted: | 0.428 |
| Caco-2 Permeability: | -4.852 | MDCK Permeability: | 0.00002380 |
| Pgp-inhibitor: | 0.998 | Pgp-substrate: | 0.022 |
| Human Intestinal Absorption (HIA): | 0.024 | 20% Bioavailability (F20%): | 0.017 |
| 30% Bioavailability (F30%): | 0.629 |
| Blood-Brain-Barrier Penetration (BBB): | 0.269 | Plasma Protein Binding (PPB): | 93.93% |
| Volume Distribution (VD): | 1.822 | Fu: | 3.74% |
| CYP1A2-inhibitor: | 0.252 | CYP1A2-substrate: | 0.553 |
| CYP2C19-inhibitor: | 0.867 | CYP2C19-substrate: | 0.836 |
| CYP2C9-inhibitor: | 0.931 | CYP2C9-substrate: | 0.062 |
| CYP2D6-inhibitor: | 0.333 | CYP2D6-substrate: | 0.17 |
| CYP3A4-inhibitor: | 0.978 | CYP3A4-substrate: | 0.768 |
| Clearance (CL): | 4.601 | Half-life (T1/2): | 0.13 |
| hERG Blockers: | 0.66 | Human Hepatotoxicity (H-HT): | 0.894 |
| Drug-inuced Liver Injury (DILI): | 0.933 | AMES Toxicity: | 0.55 |
| Rat Oral Acute Toxicity: | 0.593 | Maximum Recommended Daily Dose: | 0.987 |
| Skin Sensitization: | 0.087 | Carcinogencity: | 0.08 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
| Respiratory Toxicity: | 0.919 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003349 | ![]() |
0.739 | D0V4WD | ![]() |
0.219 | ||
| ENC005320 | ![]() |
0.692 | D0VA0I | ![]() |
0.216 | ||
| ENC005769 | ![]() |
0.647 | D07DIM | ![]() |
0.214 | ||
| ENC004853 | ![]() |
0.616 | D0E9KA | ![]() |
0.213 | ||
| ENC003989 | ![]() |
0.602 | D0W2EK | ![]() |
0.213 | ||
| ENC004852 | ![]() |
0.569 | D01XDL | ![]() |
0.207 | ||
| ENC003503 | ![]() |
0.566 | D0F1EX | ![]() |
0.207 | ||
| ENC003851 | ![]() |
0.565 | D0N0RU | ![]() |
0.206 | ||
| ENC005770 | ![]() |
0.485 | D0V3ZA | ![]() |
0.205 | ||
| ENC005135 | ![]() |
0.474 | D0I5DS | ![]() |
0.201 | ||