|
Name |
ascomylactam C
|
| Molecular Formula | C34H41NO5 | |
| IUPAC Name* |
21-hydroxy-4,6,7,9,13,15-hexamethyl-18,24-dioxa-22-azaoctacyclo[17.5.2.219,21.11,23.03,8.010,15.023,25.017,28]nonacosa-5,9,19(27),20,28-pentaene-2,26-dione
|
|
| SMILES |
CC1=CC2(C)C(=C(C)C3C4CC(C)CC(C)C4C4Oc5ccc(cc5)CC5(O)NC(=O)C6(OC56)C(=O)C2C43)C1C
|
|
| InChI |
InChI=1S/C34H41NO5/c1-15-11-16(2)23-22(12-15)24-19(5)26-18(4)17(3)13-32(26,6)27-25(24)28(23)39-21-9-7-20(8-10-21)14-33(38)30-34(40-30,29(27)36)31(37)35-33/h7-10,13,15-16,18,22-25,27-28,30,38H,11-12,14H2,1-6H3,(H,35,37)/t15-,16+,18+,22-,23-,24+,25+,27+,28-,30?,32+,33-,34+/m1/s1
|
|
| InChIKey |
NQFJAFJMOUIAAX-GYWZDRMASA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 543.7 | ALogp: | 4.6 |
| HBD: | 2 | HBA: | 5 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 88.2 | Aromatic Rings: | 9 |
| Heavy Atoms: | 40 | QED Weighted: | 0.271 |
| Caco-2 Permeability: | -5.086 | MDCK Permeability: | 0.00003260 |
| Pgp-inhibitor: | 0.995 | Pgp-substrate: | 0.709 |
| Human Intestinal Absorption (HIA): | 0.016 | 20% Bioavailability (F20%): | 0.009 |
| 30% Bioavailability (F30%): | 0.325 |
| Blood-Brain-Barrier Penetration (BBB): | 0.051 | Plasma Protein Binding (PPB): | 99.63% |
| Volume Distribution (VD): | 2.688 | Fu: | 1.10% |
| CYP1A2-inhibitor: | 0.02 | CYP1A2-substrate: | 0.899 |
| CYP2C19-inhibitor: | 0.832 | CYP2C19-substrate: | 0.933 |
| CYP2C9-inhibitor: | 0.33 | CYP2C9-substrate: | 0.036 |
| CYP2D6-inhibitor: | 0.041 | CYP2D6-substrate: | 0.083 |
| CYP3A4-inhibitor: | 0.974 | CYP3A4-substrate: | 0.929 |
| Clearance (CL): | 14.646 | Half-life (T1/2): | 0.003 |
| hERG Blockers: | 0.011 | Human Hepatotoxicity (H-HT): | 0.378 |
| Drug-inuced Liver Injury (DILI): | 0.967 | AMES Toxicity: | 0.053 |
| Rat Oral Acute Toxicity: | 0.996 | Maximum Recommended Daily Dose: | 0.944 |
| Skin Sensitization: | 0.03 | Carcinogencity: | 0.226 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
| Respiratory Toxicity: | 0.973 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003606 | ![]() |
1.000 | D0TG7I | ![]() |
0.221 | ||
| ENC003773 | ![]() |
0.672 | D0W2EK | ![]() |
0.220 | ||
| ENC003240 | ![]() |
0.672 | D0I5DS | ![]() |
0.211 | ||
| ENC005135 | ![]() |
0.628 | D03LJR | ![]() |
0.210 | ||
| ENC003989 | ![]() |
0.600 | D07DIM | ![]() |
0.208 | ||
| ENC005767 | ![]() |
0.570 | D09HNR | ![]() |
0.206 | ||
| ENC005365 | ![]() |
0.534 | D0E9KA | ![]() |
0.206 | ||
| ENC005766 | ![]() |
0.489 | D01UBX | ![]() |
0.205 | ||
| ENC005768 | ![]() |
0.486 | D0K3QS | ![]() |
0.202 | ||
| ENC005769 | ![]() |
0.479 | D0VA0I | ![]() |
0.202 | ||