|
Name |
Rhizovarin B
|
| Molecular Formula | C38H46ClNO7 | |
| IUPAC Name* |
(1S,3S,7S,9R,10S,11R,16S,17S,26R,28S,29R)-22-chloro-3-methoxy-16,17,34,34-tetramethyl-25-methylidene-11-prop-1-en-2-yl-2,8,12,33-tetraoxa-19-azadecacyclo[26.4.2.03,17.06,16.07,9.07,13.018,32.020,31.023,30.026,29]tetratriaconta-18(32),20,22,30-tetraene-10,29-diol
|
|
| SMILES |
CC(=C)[C@@H]1[C@@H]([C@@H]2[C@]3(O2)C4CC[C@]5([C@@]([C@]4(CCC3O1)C)(C6=C7[C@H](O5)OC([C@H]8C[C@H]9[C@@]8(C1=C7C(=CC(=C1CC9=C)Cl)N6)O)(C)C)C)OC)O
|
|
| InChI |
InChI=1S/C38H46ClNO7/c1-16(2)29-28(41)31-38(45-31)22-9-12-36(43-8)35(7,34(22,6)11-10-24(38)44-29)30-26-25-21(40-30)15-20(39)18-13-17(3)19-14-23(37(19,42)27(18)25)33(4,5)46-32(26)47-36/h15,19,22-24,28-29,31-32,40-42H,1,3,9-14H2,2,4-8H3/t19-,22?,23-,24?,28+,29-,31-,32+,34+,35-,36+,37-,38+/m1/s1
|
|
| InChIKey |
WUURQODECZYJHH-GQWXIHMDSA-N
|
|
| Synonyms |
Rhizovarin B
|
|
| CAS | NA | |
| PubChem CID | 139589619 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 664.2 | ALogp: | 4.3 |
| HBD: | 3 | HBA: | 7 |
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 106.0 | Aromatic Rings: | 10 |
| Heavy Atoms: | 47 | QED Weighted: | 0.258 |
| Caco-2 Permeability: | -5.266 | MDCK Permeability: | 0.00001180 |
| Pgp-inhibitor: | 0.995 | Pgp-substrate: | 0.992 |
| Human Intestinal Absorption (HIA): | 0.017 | 20% Bioavailability (F20%): | 0.01 |
| 30% Bioavailability (F30%): | 0.126 |
| Blood-Brain-Barrier Penetration (BBB): | 0.951 | Plasma Protein Binding (PPB): | 91.88% |
| Volume Distribution (VD): | 2.254 | Fu: | 2.41% |
| CYP1A2-inhibitor: | 0.018 | CYP1A2-substrate: | 0.995 |
| CYP2C19-inhibitor: | 0.148 | CYP2C19-substrate: | 0.84 |
| CYP2C9-inhibitor: | 0.354 | CYP2C9-substrate: | 0.039 |
| CYP2D6-inhibitor: | 0.03 | CYP2D6-substrate: | 0.469 |
| CYP3A4-inhibitor: | 0.858 | CYP3A4-substrate: | 0.914 |
| Clearance (CL): | 8.007 | Half-life (T1/2): | 0.013 |
| hERG Blockers: | 0.89 | Human Hepatotoxicity (H-HT): | 0.973 |
| Drug-inuced Liver Injury (DILI): | 0.878 | AMES Toxicity: | 0.128 |
| Rat Oral Acute Toxicity: | 0.976 | Maximum Recommended Daily Dose: | 0.993 |
| Skin Sensitization: | 0.566 | Carcinogencity: | 0.841 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.01 |
| Respiratory Toxicity: | 0.988 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003831 | ![]() |
0.843 | D03MTN | ![]() |
0.221 | ||
| ENC005404 | ![]() |
0.704 | D0W2EK | ![]() |
0.217 | ||
| ENC001891 | ![]() |
0.660 | D06IIB | ![]() |
0.216 | ||
| ENC001508 | ![]() |
0.546 | D0KR9U | ![]() |
0.212 | ||
| ENC001507 | ![]() |
0.527 | D0X7XG | ![]() |
0.212 | ||
| ENC003453 | ![]() |
0.448 | D06AEO | ![]() |
0.211 | ||
| ENC001499 | ![]() |
0.445 | D0Y2YP | ![]() |
0.209 | ||
| ENC001486 | ![]() |
0.380 | D0S0NK | ![]() |
0.204 | ||
| ENC003833 | ![]() |
0.344 | D0V3GA | ![]() |
0.204 | ||
| ENC003330 | ![]() |
0.337 | D0M2QH | ![]() |
0.202 | ||