|
Name |
Penitrem F
|
| Molecular Formula | C37H44ClNO5 | |
| IUPAC Name* |
(1S,2R,5S,6S,8R,9S,10R,12S,15R,16S,25S,27S,28S)-21-chloro-15,16,33,33-tetramethyl-24-methylidene-10-prop-1-en-2-yl-7,11,32-trioxa-18-azadecacyclo[25.4.2.02,16.05,15.06,8.06,12.017,31.019,30.022,29.025,28]tritriaconta-17(31),19,21,29-tetraene-5,9-diol
|
|
| SMILES |
CC(=C)[C@@H]1[C@@H]([C@@H]2[C@@]3(O2)[C@@H](O1)CC[C@]4([C@]3(CC[C@@H]5[C@@]4(C6=C7[C@H]5OC([C@H]8C[C@H]9[C@@H]8C1=C7C(=CC(=C1CC9=C)Cl)N6)(C)C)C)O)C)O
|
|
| InChI |
InChI=1S/C37H44ClNO5/c1-15(2)29-28(40)32-37(44-32)23(42-29)9-10-34(6)35(7)19(8-11-36(34,37)41)30-27-26-22(39-31(27)35)14-21(38)18-12-16(3)17-13-20(24(17)25(18)26)33(4,5)43-30/h14,17,19-20,23-24,28-30,32,39-41H,1,3,8-13H2,2,4-7H3/t17-,19+,20+,23+,24+,28+,29-,30+,32-,34-,35-,36+,37+/m1/s1
|
|
| InChIKey |
YWORPEZTBDVGCS-JCMMWUKFSA-N
|
|
| Synonyms |
PENITREM F; 78213-65-7; 15-Deoxypenitrem A; Penitrem A, 15-deoxy-; CHEMBL2272678; DTXSID50999455; CHEBI:176916; 7,8-(Epoxymethano)-2H,6H-cyclobuta(5,6)benz(1,2-e)oxireno(4',4'a)-1-benzopyrano(5',6':6,7)indeno(1,2-b)indole-3,4b(5H)-diol,12-chloro-3,3a,6a,7,7d,8,9,9a,10,11,14,14b,14c,15,16,16a-hexadecahydro-14b,14c,17,17-tetramethyl-10-methylene-2-(1-methylethenyl)-, (2R,3S,3aR,4aS,4bS,6aR,7S,7dS,8S,9aS,14bS,14cR,16aS)-; C20598; (1S,2R,5S,6S,8R,9S,10R,12S,15R,16S,25S,27S,28S)-21-chloro-15,16,33,33-tetramethyl-24-methylidene-10-prop-1-en-2-yl-7,11,32-trioxa-18-azadecacyclo[25.4.2.02,16.05,15.06,8.06,12.017,31.019,30.022,29.025,28]tritriaconta-17(31),19,21,29-tetraene-5,9-diol; 12-Chloro-8,8,15a,15b-tetramethyl-10-methylidene-2-(prop-1-en-2-yl)-3,3a,5,6,6a,6b,8,8a,9,9a,10,11,11c,15a,15b,16,17,17a-octadecahydro-2H,4bH-14,15-epiminobenzo[fg]cyclobuta[kl]indeno[1,2-d][3]benzoxocine-3,4b-diol
|
|
| CAS | 78213-65-7 | |
| PubChem CID | 3086086 | |
| ChEMBL ID | CHEMBL2272678 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 618.2 | ALogp: | 4.8 |
| HBD: | 3 | HBA: | 5 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 87.2 | Aromatic Rings: | 10 |
| Heavy Atoms: | 44 | QED Weighted: | 0.251 |
| Caco-2 Permeability: | -5.319 | MDCK Permeability: | 0.00001070 |
| Pgp-inhibitor: | 0.946 | Pgp-substrate: | 0.994 |
| Human Intestinal Absorption (HIA): | 0.013 | 20% Bioavailability (F20%): | 0.845 |
| 30% Bioavailability (F30%): | 0.559 |
| Blood-Brain-Barrier Penetration (BBB): | 0.915 | Plasma Protein Binding (PPB): | 93.15% |
| Volume Distribution (VD): | 2.279 | Fu: | 3.07% |
| CYP1A2-inhibitor: | 0.041 | CYP1A2-substrate: | 0.973 |
| CYP2C19-inhibitor: | 0.199 | CYP2C19-substrate: | 0.795 |
| CYP2C9-inhibitor: | 0.374 | CYP2C9-substrate: | 0.062 |
| CYP2D6-inhibitor: | 0.079 | CYP2D6-substrate: | 0.31 |
| CYP3A4-inhibitor: | 0.73 | CYP3A4-substrate: | 0.914 |
| Clearance (CL): | 7.264 | Half-life (T1/2): | 0.013 |
| hERG Blockers: | 0.968 | Human Hepatotoxicity (H-HT): | 0.336 |
| Drug-inuced Liver Injury (DILI): | 0.888 | AMES Toxicity: | 0.017 |
| Rat Oral Acute Toxicity: | 0.979 | Maximum Recommended Daily Dose: | 0.984 |
| Skin Sensitization: | 0.462 | Carcinogencity: | 0.916 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.01 |
| Respiratory Toxicity: | 0.992 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001499 | ![]() |
0.833 | D06AEO | ![]() |
0.245 | ||
| ENC001891 | ![]() |
0.783 | D06IIB | ![]() |
0.234 | ||
| ENC003453 | ![]() |
0.734 | D0W2EK | ![]() |
0.220 | ||
| ENC001508 | ![]() |
0.671 | D0Y2YP | ![]() |
0.219 | ||
| ENC001486 | ![]() |
0.615 | D0I2SD | ![]() |
0.218 | ||
| ENC005404 | ![]() |
0.599 | D0L2LS | ![]() |
0.214 | ||
| ENC003830 | ![]() |
0.527 | D0KR9U | ![]() |
0.214 | ||
| ENC003833 | ![]() |
0.509 | D0M2QH | ![]() |
0.211 | ||
| ENC003831 | ![]() |
0.445 | D04GJN | ![]() |
0.210 | ||
| ENC003330 | ![]() |
0.408 | D0M4WA | ![]() |
0.207 | ||