|
Name |
penitrem D
|
| Molecular Formula | C37H45NO4 | |
| IUPAC Name* |
(1S,2R,5S,8R,9R,11S,14R,15S,24S,26S,27S)-14,15,32,32-tetramethyl-23-methylidene-9-prop-1-en-2-yl-10,31-dioxa-17-azanonacyclo[24.4.2.02,15.05,14.06,11.016,30.018,29.021,28.024,27]dotriaconta-6,16(30),18(29),19,21(28)-pentaene-5,8-diol
|
|
| SMILES |
CC(=C)[C@@H]1[C@@H](C=C2[C@@H](O1)CC[C@]3([C@]2(CC[C@@H]4[C@@]3(C5=C6[C@H]4OC([C@H]7C[C@H]8[C@@H]7C9=C(CC8=C)C=CC(=C96)N5)(C)C)C)O)C)O
|
|
| InChI |
InChI=1S/C37H45NO4/c1-17(2)31-25(39)16-22-26(41-31)11-12-35(6)36(7)21(10-13-37(22,35)40)32-30-29-24(38-33(30)36)9-8-19-14-18(3)20-15-23(28(20)27(19)29)34(4,5)42-32/h8-9,16,20-21,23,25-26,28,31-32,38-40H,1,3,10-15H2,2,4-7H3/t20-,21+,23+,25-,26+,28+,31-,32+,35-,36-,37-/m1/s1
|
|
| InChIKey |
XOASTWITKYDKAJ-PPQPEBMASA-N
|
|
| Synonyms |
penitrem D; 78213-64-6; (1S,2R,5S,8R,9R,11S,14R,15S,24S,26S,27S)-14,15,32,32-tetramethyl-23-methylidene-9-prop-1-en-2-yl-10,31-dioxa-17-azanonacyclo[24.4.2.02,15.05,14.06,11.016,30.018,29.021,28.024,27]dotriaconta-6,16(30),18(29),19,21(28)-pentaene-5,8-diol; (-)-Penitrem D; CHEMBL3900152; DTXSID90999454; CHEBI:138854; Penitrem A, 6-dechloro-23,24-deepoxy-23,24-didehydro-15-deoxy-; 7,8-(Epoxymethano)-4bH-1-benzopyrano(5',6':6,7)indeno(1,2-b)cyclobuta(5,6)benz(5,6)benz(1,2-e)indole-3,4b-diol, 2,3,5,6,6a,7,7d,8,9,9a,10,11,14,14b,14c,15,16,16a-octadecahydro-14b,14c,17,17-tetramethyl-10-methylene-2-(1-methylethenyl)-, (2R,3R,4bS,6aR,7S,7dS,8S,9aS,14bS,14cR,16aS)-; C20596; 8,8,15a,15b-Tetramethyl-10-methylidene-2-(prop-1-en-2-yl)-2,3,5,6,6a,6b,8,8a,9,9a,10,11,11c,15a,15b,16,17,17a-octadecahydro-4bH-14,15-epiminobenzo[fg]cyclobuta[kl]indeno[1,2-d][3]benzoxocine-3,4b-diol
|
|
| CAS | 78213-64-6 | |
| PubChem CID | 3035208 | |
| ChEMBL ID | CHEMBL3900152 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 567.8 | ALogp: | 4.7 |
| HBD: | 3 | HBA: | 4 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 74.7 | Aromatic Rings: | 9 |
| Heavy Atoms: | 42 | QED Weighted: | 0.338 |
| Caco-2 Permeability: | -5.208 | MDCK Permeability: | 0.00001030 |
| Pgp-inhibitor: | 0.99 | Pgp-substrate: | 0.978 |
| Human Intestinal Absorption (HIA): | 0.011 | 20% Bioavailability (F20%): | 0.727 |
| 30% Bioavailability (F30%): | 0.077 |
| Blood-Brain-Barrier Penetration (BBB): | 0.874 | Plasma Protein Binding (PPB): | 85.97% |
| Volume Distribution (VD): | 2.411 | Fu: | 7.43% |
| CYP1A2-inhibitor: | 0.024 | CYP1A2-substrate: | 0.94 |
| CYP2C19-inhibitor: | 0.316 | CYP2C19-substrate: | 0.812 |
| CYP2C9-inhibitor: | 0.262 | CYP2C9-substrate: | 0.103 |
| CYP2D6-inhibitor: | 0.098 | CYP2D6-substrate: | 0.3 |
| CYP3A4-inhibitor: | 0.794 | CYP3A4-substrate: | 0.919 |
| Clearance (CL): | 6.011 | Half-life (T1/2): | 0.006 |
| hERG Blockers: | 0.851 | Human Hepatotoxicity (H-HT): | 0.299 |
| Drug-inuced Liver Injury (DILI): | 0.647 | AMES Toxicity: | 0.019 |
| Rat Oral Acute Toxicity: | 0.993 | Maximum Recommended Daily Dose: | 0.975 |
| Skin Sensitization: | 0.111 | Carcinogencity: | 0.896 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.011 |
| Respiratory Toxicity: | 0.991 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003453 | ![]() |
0.829 | D06AEO | ![]() |
0.253 | ||
| ENC001499 | ![]() |
0.730 | D0P0HT | ![]() |
0.235 | ||
| ENC003330 | ![]() |
0.676 | D04GJN | ![]() |
0.233 | ||
| ENC001507 | ![]() |
0.615 | D0I2SD | ![]() |
0.233 | ||
| ENC003329 | ![]() |
0.578 | D0Y2YP | ![]() |
0.226 | ||
| ENC001508 | ![]() |
0.572 | D0L2LS | ![]() |
0.221 | ||
| ENC003833 | ![]() |
0.525 | D02JNM | ![]() |
0.221 | ||
| ENC001891 | ![]() |
0.497 | D0V4WD | ![]() |
0.219 | ||
| ENC003660 | ![]() |
0.457 | D06IIB | ![]() |
0.218 | ||
| ENC003831 | ![]() |
0.441 | D06NXY | ![]() |
0.218 | ||