|
Name |
Fumiquinazoline C
|
| Molecular Formula | C24H21N5O4 | |
| IUPAC Name* |
(1S,3S,12S,14R,27S)-12-hydroxy-1,3-dimethyl-2,5,15,23,25-pentazaheptacyclo[12.10.2.12,5.06,11.015,24.017,22.012,27]heptacosa-6,8,10,17,19,21,23-heptaene-4,16,26-trione
|
|
| SMILES |
C[C@H]1C(=O)N2[C@@H]3N1[C@]4(C5=NC6=CC=CC=C6C(=O)N5[C@H](C[C@@]3(C7=CC=CC=C72)O)C(=O)N4)C
|
|
| InChI |
InChI=1S/C24H21N5O4/c1-12-19(31)28-16-10-6-4-8-14(16)24(33)11-17-18(30)26-23(2,29(12)22(24)28)21-25-15-9-5-3-7-13(15)20(32)27(17)21/h3-10,12,17,22,33H,11H2,1-2H3,(H,26,30)/t12-,17+,22+,23-,24-/m0/s1
|
|
| InChIKey |
YYLAARMDRFESOL-CVAYNVNESA-N
|
|
| Synonyms |
MEGxm0_000130; CHEMBL2229119; SCHEMBL12931230; ACon0_000208; ACon1_001166; CHEBI:181521; ZINC103216961; NCGC00169614-01; NCGC00169614-02; C22149; (1S,3S,12S,14R,27S)-12-hydroxy-1,3-dimethyl-2,5,15,23,25-pentazaheptacyclo[12.10.2.12,5.06,11.015,24.017,22.012,27]heptacosa-6,8,10,17,19,21,23-heptaene-4,16,26-trione; NCGC00169614-02_C24H21N5O4_(1S,3S,12S,14R,27S)-12-Hydroxy-1,3-dimethyl-2,5,15,23,25-pentaazaheptacyclo[12.10.2.1~2,5~.0~6,11~.0~12,27~.0~15,24~.0~17,22~]heptacosa-6,8,10,17,19,21,23-heptaene-4,16,26-trione (Fumiquinazoline C)
|
|
| CAS | NA | |
| PubChem CID | 9980845 | |
| ChEMBL ID | CHEMBL2229119 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 443.5 | ALogp: | 0.7 |
| HBD: | 2 | HBA: | 6 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 106.0 | Aromatic Rings: | 8 |
| Heavy Atoms: | 33 | QED Weighted: | 0.543 |
| Caco-2 Permeability: | -5.456 | MDCK Permeability: | 0.00005090 |
| Pgp-inhibitor: | 0.105 | Pgp-substrate: | 0.008 |
| Human Intestinal Absorption (HIA): | 0.011 | 20% Bioavailability (F20%): | 0.039 |
| 30% Bioavailability (F30%): | 0.09 |
| Blood-Brain-Barrier Penetration (BBB): | 0.169 | Plasma Protein Binding (PPB): | 70.53% |
| Volume Distribution (VD): | 2.361 | Fu: | 30.83% |
| CYP1A2-inhibitor: | 0.033 | CYP1A2-substrate: | 0.174 |
| CYP2C19-inhibitor: | 0.069 | CYP2C19-substrate: | 0.431 |
| CYP2C9-inhibitor: | 0.655 | CYP2C9-substrate: | 0.862 |
| CYP2D6-inhibitor: | 0.009 | CYP2D6-substrate: | 0.136 |
| CYP3A4-inhibitor: | 0.607 | CYP3A4-substrate: | 0.954 |
| Clearance (CL): | 4.284 | Half-life (T1/2): | 0.196 |
| hERG Blockers: | 0.004 | Human Hepatotoxicity (H-HT): | 0.749 |
| Drug-inuced Liver Injury (DILI): | 0.995 | AMES Toxicity: | 0.018 |
| Rat Oral Acute Toxicity: | 0.398 | Maximum Recommended Daily Dose: | 0.908 |
| Skin Sensitization: | 0.823 | Carcinogencity: | 0.056 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.013 |
| Respiratory Toxicity: | 0.902 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002357 | ![]() |
0.633 | D0V9WF | ![]() |
0.315 | ||
| ENC002409 | ![]() |
0.593 | D0G9YH | ![]() |
0.291 | ||
| ENC003647 | ![]() |
0.578 | D01TSI | ![]() |
0.286 | ||
| ENC002127 | ![]() |
0.537 | D0DV3O | ![]() |
0.284 | ||
| ENC003601 | ![]() |
0.528 | D0QL3P | ![]() |
0.278 | ||
| ENC002868 | ![]() |
0.521 | D05MQK | ![]() |
0.273 | ||
| ENC006010 | ![]() |
0.500 | D0B1FE | ![]() |
0.273 | ||
| ENC000977 | ![]() |
0.492 | D02TJS | ![]() |
0.271 | ||
| ENC003764 | ![]() |
0.466 | D0V3ZA | ![]() |
0.271 | ||
| ENC003203 | ![]() |
0.455 | D08FTG | ![]() |
0.268 | ||