|
Name |
(E)-4-[(2R,3S,5R)-5-ethyl-3-methyloxolan-2-yl]-4-hydroxy-N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]pent-2-enamide
|
| Molecular Formula | C18H33NO4 | |
| IUPAC Name* |
(E)-4-[(2R,3S,5R)-5-ethyl-3-methyloxolan-2-yl]-4-hydroxy-N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]pent-2-enamide
|
|
| SMILES |
CC[C@@H]1C[C@@H]([C@@H](O1)C(C)(/C=C/C(=O)N[C@H](CO)[C@@H](C)CC)O)C
|
|
| InChI |
InChI=1S/C18H33NO4/c1-6-12(3)15(11-20)19-16(21)8-9-18(5,22)17-13(4)10-14(7-2)23-17/h8-9,12-15,17,20,22H,6-7,10-11H2,1-5H3,(H,19,21)/b9-8+/t12-,13-,14+,15+,17+,18?/m0/s1
|
|
| InChIKey |
AKQLFHXLRLKXAB-KRLGEISQSA-N
|
|
| Synonyms |
Curvularide E
|
|
| CAS | NA | |
| PubChem CID | 139586852 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 327.5 | ALogp: | 2.2 |
| HBD: | 3 | HBA: | 4 |
| Rotatable Bonds: | 8 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 78.8 | Aromatic Rings: | 1 |
| Heavy Atoms: | 23 | QED Weighted: | 0.599 |
| Caco-2 Permeability: | -4.597 | MDCK Permeability: | 0.00001450 |
| Pgp-inhibitor: | 0.029 | Pgp-substrate: | 0.175 |
| Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.017 |
| 30% Bioavailability (F30%): | 0.003 |
| Blood-Brain-Barrier Penetration (BBB): | 0.795 | Plasma Protein Binding (PPB): | 53.63% |
| Volume Distribution (VD): | 0.67 | Fu: | 37.71% |
| CYP1A2-inhibitor: | 0.028 | CYP1A2-substrate: | 0.306 |
| CYP2C19-inhibitor: | 0.035 | CYP2C19-substrate: | 0.792 |
| CYP2C9-inhibitor: | 0.024 | CYP2C9-substrate: | 0.194 |
| CYP2D6-inhibitor: | 0.005 | CYP2D6-substrate: | 0.098 |
| CYP3A4-inhibitor: | 0.166 | CYP3A4-substrate: | 0.399 |
| Clearance (CL): | 8.125 | Half-life (T1/2): | 0.631 |
| hERG Blockers: | 0.043 | Human Hepatotoxicity (H-HT): | 0.583 |
| Drug-inuced Liver Injury (DILI): | 0.74 | AMES Toxicity: | 0.676 |
| Rat Oral Acute Toxicity: | 0.03 | Maximum Recommended Daily Dose: | 0.046 |
| Skin Sensitization: | 0.683 | Carcinogencity: | 0.769 |
| Eye Corrosion: | 0.016 | Eye Irritation: | 0.606 |
| Respiratory Toxicity: | 0.744 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002712 | ![]() |
0.482 | D0P2IW | ![]() |
0.222 | ||
| ENC002713 | ![]() |
0.448 | D0Q0EX | ![]() |
0.220 | ||
| ENC002937 | ![]() |
0.435 | D0R0ZL | ![]() |
0.220 | ||
| ENC003222 | ![]() |
0.419 | D06WTZ | ![]() |
0.195 | ||
| ENC003234 | ![]() |
0.329 | D0H0ND | ![]() |
0.192 | ||
| ENC003253 | ![]() |
0.315 | D03KYG | ![]() |
0.189 | ||
| ENC006086 | ![]() |
0.264 | D0O5NK | ![]() |
0.188 | ||
| ENC005743 | ![]() |
0.247 | D05ZTH | ![]() |
0.188 | ||
| ENC006058 | ![]() |
0.244 | D05PLH | ![]() |
0.187 | ||
| ENC006057 | ![]() |
0.244 | D0N3NO | ![]() |
0.184 | ||