![]() |
Name |
Curvularide A
|
Molecular Formula | C18H35NO5 | |
IUPAC Name* |
(E,4R,5S,6S,8R)-4,5,8-trihydroxy-N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-4,6-dimethyldec-2-enamide
|
|
SMILES |
CC[C@H](C)[C@@H](CO)NC(=O)/C=C/[C@](C)([C@H]([C@@H](C)C[C@@H](CC)O)O)O
|
|
InChI |
InChI=1S/C18H35NO5/c1-6-12(3)15(11-20)19-16(22)8-9-18(5,24)17(23)13(4)10-14(21)7-2/h8-9,12-15,17,20-21,23-24H,6-7,10-11H2,1-5H3,(H,19,22)/b9-8+/t12-,13-,14+,15+,17-,18+/m0/s1
|
|
InChIKey |
JNKVLRPMBOJUOI-WXDFVLQISA-N
|
|
Synonyms |
Curvularide A
|
|
CAS | NA | |
PubChem CID | 49818155 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 345.5 | ALogp: | 1.2 |
HBD: | 5 | HBA: | 5 |
Rotatable Bonds: | 11 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 110.0 | Aromatic Rings: | 0 |
Heavy Atoms: | 24 | QED Weighted: | 0.364 |
Caco-2 Permeability: | -4.963 | MDCK Permeability: | 0.00009220 |
Pgp-inhibitor: | 0.03 | Pgp-substrate: | 0.972 |
Human Intestinal Absorption (HIA): | 0.05 | 20% Bioavailability (F20%): | 0.011 |
30% Bioavailability (F30%): | 0.003 |
Blood-Brain-Barrier Penetration (BBB): | 0.347 | Plasma Protein Binding (PPB): | 31.99% |
Volume Distribution (VD): | 0.561 | Fu: | 47.42% |
CYP1A2-inhibitor: | 0.02 | CYP1A2-substrate: | 0.204 |
CYP2C19-inhibitor: | 0.023 | CYP2C19-substrate: | 0.756 |
CYP2C9-inhibitor: | 0.009 | CYP2C9-substrate: | 0.54 |
CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.099 |
CYP3A4-inhibitor: | 0.03 | CYP3A4-substrate: | 0.243 |
Clearance (CL): | 6.436 | Half-life (T1/2): | 0.824 |
hERG Blockers: | 0.06 | Human Hepatotoxicity (H-HT): | 0.395 |
Drug-inuced Liver Injury (DILI): | 0.244 | AMES Toxicity: | 0.036 |
Rat Oral Acute Toxicity: | 0.009 | Maximum Recommended Daily Dose: | 0.059 |
Skin Sensitization: | 0.524 | Carcinogencity: | 0.127 |
Eye Corrosion: | 0.011 | Eye Irritation: | 0.718 |
Respiratory Toxicity: | 0.583 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002713 | ![]() |
0.789 | D05PLH | ![]() |
0.211 | ||
ENC002937 | ![]() |
0.577 | D06HZY | ![]() |
0.211 | ||
ENC003711 | ![]() |
0.482 | D03KIA | ![]() |
0.208 | ||
ENC003222 | ![]() |
0.430 | D08QME | ![]() |
0.205 | ||
ENC003234 | ![]() |
0.395 | D07SJT | ![]() |
0.205 | ||
ENC004454 | ![]() |
0.368 | D02RQU | ![]() |
0.202 | ||
ENC003253 | ![]() |
0.312 | D0VM8K | ![]() |
0.200 | ||
ENC002873 | ![]() |
0.293 | D0T6VD | ![]() |
0.198 | ||
ENC006086 | ![]() |
0.289 | D02KFP | ![]() |
0.196 | ||
ENC005376 | ![]() |
0.287 | D08HUC | ![]() |
0.189 |