![]() |
Name |
Curvularide C
|
Molecular Formula | C19H37NO5 | |
IUPAC Name* |
(E,4R,5S,6S,8R)-5,8-dihydroxy-N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-4-methoxy-4,6-dimethyldec-2-enamide
|
|
SMILES |
CC[C@H](C)[C@@H](CO)NC(=O)/C=C/[C@](C)([C@H]([C@@H](C)C[C@@H](CC)O)O)OC
|
|
InChI |
InChI=1S/C19H37NO5/c1-7-13(3)16(12-21)20-17(23)9-10-19(5,25-6)18(24)14(4)11-15(22)8-2/h9-10,13-16,18,21-22,24H,7-8,11-12H2,1-6H3,(H,20,23)/b10-9+/t13-,14-,15+,16+,18-,19+/m0/s1
|
|
InChIKey |
BZLIDAVUQDTJQF-HWTFSWDCSA-N
|
|
Synonyms |
Curvularide C
|
|
CAS | NA | |
PubChem CID | 49818157 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 359.5 | ALogp: | 1.8 |
HBD: | 4 | HBA: | 5 |
Rotatable Bonds: | 12 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 99.0 | Aromatic Rings: | 0 |
Heavy Atoms: | 25 | QED Weighted: | 0.4 |
Caco-2 Permeability: | -4.897 | MDCK Permeability: | 0.00002860 |
Pgp-inhibitor: | 0.448 | Pgp-substrate: | 0.968 |
Human Intestinal Absorption (HIA): | 0.017 | 20% Bioavailability (F20%): | 0.166 |
30% Bioavailability (F30%): | 0.004 |
Blood-Brain-Barrier Penetration (BBB): | 0.24 | Plasma Protein Binding (PPB): | 32.55% |
Volume Distribution (VD): | 0.731 | Fu: | 48.29% |
CYP1A2-inhibitor: | 0.017 | CYP1A2-substrate: | 0.43 |
CYP2C19-inhibitor: | 0.024 | CYP2C19-substrate: | 0.834 |
CYP2C9-inhibitor: | 0.014 | CYP2C9-substrate: | 0.182 |
CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.169 |
CYP3A4-inhibitor: | 0.065 | CYP3A4-substrate: | 0.396 |
Clearance (CL): | 8.196 | Half-life (T1/2): | 0.838 |
hERG Blockers: | 0.056 | Human Hepatotoxicity (H-HT): | 0.439 |
Drug-inuced Liver Injury (DILI): | 0.151 | AMES Toxicity: | 0.08 |
Rat Oral Acute Toxicity: | 0.018 | Maximum Recommended Daily Dose: | 0.04 |
Skin Sensitization: | 0.63 | Carcinogencity: | 0.332 |
Eye Corrosion: | 0.015 | Eye Irritation: | 0.525 |
Respiratory Toxicity: | 0.747 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002712 | ![]() |
0.789 | D03KIA | ![]() |
0.222 | ||
ENC002937 | ![]() |
0.556 | D05PLH | ![]() |
0.217 | ||
ENC003711 | ![]() |
0.448 | D0AY7K | ![]() |
0.200 | ||
ENC003222 | ![]() |
0.416 | D03SVX | ![]() |
0.199 | ||
ENC003234 | ![]() |
0.380 | D08QME | ![]() |
0.198 | ||
ENC004454 | ![]() |
0.341 | D07SJT | ![]() |
0.198 | ||
ENC006086 | ![]() |
0.293 | D02RQU | ![]() |
0.197 | ||
ENC005376 | ![]() |
0.292 | D0L5FY | ![]() |
0.194 | ||
ENC003253 | ![]() |
0.289 | D03XTC | ![]() |
0.194 | ||
ENC001171 | ![]() |
0.284 | D0HD9K | ![]() |
0.193 |