| 
                    Name | 
                         (E)-7-(3-methyl-4-oxo-6,7,8,8a-tetrahydro-4H-pyrrolo[2,1-b][1,3]oxazin-2-yl)hept-2-enoic acid 
                     | 
                
| Molecular Formula | C15H21NO4 | |
| IUPAC Name* | 
                         (E)-7-(3-methyl-4-oxo-6,7,8,8a-tetrahydropyrrolo[2,1-b][1,3]oxazin-2-yl)hept-2-enoic acid 
                     | 
                |
| SMILES | 
                         CC1=C(OC2CCCN2C1=O)CCCC/C=C/C(=O)O 
                     | 
                |
| InChI | 
                         InChI=1S/C15H21NO4/c1-11-12(7-4-2-3-5-9-14(17)18)20-13-8-6-10-16(13)15(11)19/h5,9,13H,2-4,6-8,10H2,1H3,(H,17,18)/b9-5+ 
                     | 
                |
| InChIKey | 
                         VAXDOPFIFJJTAB-WEVVVXLNSA-N 
                     | 
                |
| Synonyms | 
                         (E)-7-(3-methyl-4-oxo-6,7,8,8a-tetrahydro-4H-pyrrolo[2,1-b][1,3]oxazin-2-yl)hept-2-enoic acid 
                     | 
                |
| CAS | NA | |
| PubChem CID | 139585767 | |
| ChEMBL ID | NA | 
Chemical Classification: | 
                    
                        
  | 
                    
                        
                            
                     | 
                
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | 
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | 
| Molecular Weight: | 279.33 | ALogp: | 2.2 | 
| HBD: | 1 | HBA: | 4 | 
| Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted | 
| Polar Surface Area: | 66.8 | Aromatic Rings: | 2 | 
| Heavy Atoms: | 20 | QED Weighted: | 0.599 | 
| Caco-2 Permeability: | -5.141 | MDCK Permeability: | 0.00007990 | 
| Pgp-inhibitor: | 0.004 | Pgp-substrate: | 0.007 | 
| Human Intestinal Absorption (HIA): | 0.013 | 20% Bioavailability (F20%): | 0.002 | 
| 30% Bioavailability (F30%): | 0.007 | 
| Blood-Brain-Barrier Penetration (BBB): | 0.51 | Plasma Protein Binding (PPB): | 77.23% | 
| Volume Distribution (VD): | 0.308 | Fu: | 18.90% | 
| CYP1A2-inhibitor: | 0.018 | CYP1A2-substrate: | 0.094 | 
| CYP2C19-inhibitor: | 0.03 | CYP2C19-substrate: | 0.108 | 
| CYP2C9-inhibitor: | 0.006 | CYP2C9-substrate: | 0.946 | 
| CYP2D6-inhibitor: | 0.031 | CYP2D6-substrate: | 0.165 | 
| CYP3A4-inhibitor: | 0.038 | CYP3A4-substrate: | 0.049 | 
| Clearance (CL): | 5.898 | Half-life (T1/2): | 0.787 | 
| hERG Blockers: | 0.004 | Human Hepatotoxicity (H-HT): | 0.398 | 
| Drug-inuced Liver Injury (DILI): | 0.053 | AMES Toxicity: | 0.012 | 
| Rat Oral Acute Toxicity: | 0.002 | Maximum Recommended Daily Dose: | 0.581 | 
| Skin Sensitization: | 0.604 | Carcinogencity: | 0.427 | 
| Eye Corrosion: | 0.126 | Eye Irritation: | 0.109 | 
| Respiratory Toxicity: | 0.036 | 
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002792 | ![]()  | 
                    0.754 | D0N3NO | ![]()  | 
                    0.275 | ||
| ENC006018 | ![]()  | 
                    0.754 | D0I0EG | ![]()  | 
                    0.224 | ||
| ENC006016 | ![]()  | 
                    0.363 | D0ED7U | ![]()  | 
                    0.221 | ||
| ENC001587 | ![]()  | 
                    0.348 | D0X7JN | ![]()  | 
                    0.221 | ||
| ENC006017 | ![]()  | 
                    0.333 | D06FEA | ![]()  | 
                    0.214 | ||
| ENC001588 | ![]()  | 
                    0.319 | D02IIW | ![]()  | 
                    0.213 | ||
| ENC001586 | ![]()  | 
                    0.283 | D0A0FL | ![]()  | 
                    0.211 | ||
| ENC003607 | ![]()  | 
                    0.282 | D09QUQ | ![]()  | 
                    0.211 | ||
| ENC005465 | ![]()  | 
                    0.273 | D0U5CE | ![]()  | 
                    0.206 | ||
| ENC001668 | ![]()  | 
                    0.265 | D03LGG | ![]()  | 
                    0.206 | ||