![]() |
Name |
2-Decenoic acid
|
Molecular Formula | C10H18O2 | |
IUPAC Name* |
(E)-dec-2-enoic acid
|
|
SMILES |
CCCCCCC/C=C/C(=O)O
|
|
InChI |
InChI=1S/C10H18O2/c1-2-3-4-5-6-7-8-9-10(11)12/h8-9H,2-7H2,1H3,(H,11,12)/b9-8+
|
|
InChIKey |
WXBXVVIUZANZAU-CMDGGOBGSA-N
|
|
Synonyms |
2-Decenoic acid; trans-2-Decenoic Acid; 334-49-6; (E)-2-Decenoic acid; (E)-dec-2-enoic acid; Decenoic acid; Dec-2-enoic acid; 5- and 6-Decenoic acid; trans-2-Decylenic Acid; 2E-DECENOIC ACID; 2-Decenoic acid, (E)-; E-2-Decenoic acid; 5(6)-Decenoic acid; trans-dec-2-enoic acid; 3913-85-7; 26446-27-5; CHEBI:50467; 72881-27-7; 332T8TH7B1; C10:1n-8; 1-nonenylcarboxylic acid; 2-Decenoic acid, (2E)-; UNII-332T8TH7B1; 2-Decensaeure; 2-decylenic acid; 3E-decenoic acid; 2E-decylenic acid; Dec-2-en-saeure; EINECS 206-378-5; EINECS 247-698-5; SDSF; (2E)-decenoic acid; (E)-2-decenoicacid; (E)-2-Decensaeure; 2-trans-decenoic acid; (Z)-2-decanoic acid; (2E)-2-Decenoic acid; (2E)-dec-2-enoic acid; 10:1, n-8 trans; C10:1, n-8 trans; (2E)-2-Decenoic acid #; SCHEMBL417923; SCHEMBL417924; CHEMBL2229622; FEMA NO. 3913; UNII-8H370297TA; CHEBI:50465; 2-DECENOIC ACID, TRANS-; DTXSID20904657; ZINC1691018; 5&6 Decenoic Acid (Milk Lactone); LMFA01030029; MFCD00039530; (E)-2-DECENOIC ACID [FHFI]; AKOS004908023; AKOS037645109; Streptococcus Diffusible Signal Factor; 8H370297TA; AS-57206; BS-22322; C10:1; D0098; A14963; EN300-193394; A913342; J-009460; J-019190; Q27122082; r-4-aminomethyl-thiazolidine-3-carboxylicacidtert-butylester
|
|
CAS | 334-49-6 | |
PubChem CID | 5282724 | |
ChEMBL ID | CHEMBL2229622 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 170.25 | ALogp: | 3.8 |
HBD: | 1 | HBA: | 2 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 37.3 | Aromatic Rings: | 0 |
Heavy Atoms: | 12 | QED Weighted: | 0.466 |
Caco-2 Permeability: | -4.549 | MDCK Permeability: | 0.00001860 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.054 |
Blood-Brain-Barrier Penetration (BBB): | 0.85 | Plasma Protein Binding (PPB): | 93.94% |
Volume Distribution (VD): | 0.28 | Fu: | 7.68% |
CYP1A2-inhibitor: | 0.05 | CYP1A2-substrate: | 0.265 |
CYP2C19-inhibitor: | 0.022 | CYP2C19-substrate: | 0.32 |
CYP2C9-inhibitor: | 0.056 | CYP2C9-substrate: | 0.967 |
CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.14 |
CYP3A4-inhibitor: | 0.013 | CYP3A4-substrate: | 0.04 |
Clearance (CL): | 6.102 | Half-life (T1/2): | 0.822 |
hERG Blockers: | 0.007 | Human Hepatotoxicity (H-HT): | 0.024 |
Drug-inuced Liver Injury (DILI): | 0.021 | AMES Toxicity: | 0.007 |
Rat Oral Acute Toxicity: | 0.035 | Maximum Recommended Daily Dose: | 0.019 |
Skin Sensitization: | 0.757 | Carcinogencity: | 0.263 |
Eye Corrosion: | 0.992 | Eye Irritation: | 0.994 |
Respiratory Toxicity: | 0.201 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001588 | ![]() |
0.846 | D0O1TC | ![]() |
0.412 | ||
ENC001668 | ![]() |
0.658 | D0Z5BC | ![]() |
0.408 | ||
ENC001599 | ![]() |
0.600 | D0UE9X | ![]() |
0.406 | ||
ENC000030 | ![]() |
0.579 | D0O1PH | ![]() |
0.394 | ||
ENC001590 | ![]() |
0.579 | D0N3NO | ![]() |
0.372 | ||
ENC000032 | ![]() |
0.568 | D09SRR | ![]() |
0.333 | ||
ENC001684 | ![]() |
0.561 | D0E4WR | ![]() |
0.333 | ||
ENC001601 | ![]() |
0.558 | D0FD0H | ![]() |
0.326 | ||
ENC001586 | ![]() |
0.543 | D0AY9Q | ![]() |
0.316 | ||
ENC000263 | ![]() |
0.537 | D0XN8C | ![]() |
0.314 |