![]() |
Name |
5-Acetoxymethylfuran-3-carboxylic acid
|
Molecular Formula | C8H8O5 | |
IUPAC Name* |
5-(acetyloxymethyl)furan-3-carboxylic acid
|
|
SMILES |
CC(=O)OCC1=CC(=CO1)C(=O)O
|
|
InChI |
InChI=1S/C8H8O5/c1-5(9)12-4-7-2-6(3-13-7)8(10)11/h2-3H,4H2,1H3,(H,10,11)
|
|
InChIKey |
YVKUULHZJZWUTP-UHFFFAOYSA-N
|
|
Synonyms |
5-acetoxymethylfuran-3-carboxylic acid
|
|
CAS | NA | |
PubChem CID | 139584296 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 184.15 | ALogp: | 0.2 |
HBD: | 1 | HBA: | 5 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 76.7 | Aromatic Rings: | 1 |
Heavy Atoms: | 13 | QED Weighted: | 0.72 |
Caco-2 Permeability: | -5.21 | MDCK Permeability: | 0.00007850 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.2 | 20% Bioavailability (F20%): | 0.107 |
30% Bioavailability (F30%): | 0.015 |
Blood-Brain-Barrier Penetration (BBB): | 0.297 | Plasma Protein Binding (PPB): | 52.31% |
Volume Distribution (VD): | 0.263 | Fu: | 71.10% |
CYP1A2-inhibitor: | 0.029 | CYP1A2-substrate: | 0.087 |
CYP2C19-inhibitor: | 0.026 | CYP2C19-substrate: | 0.048 |
CYP2C9-inhibitor: | 0.015 | CYP2C9-substrate: | 0.109 |
CYP2D6-inhibitor: | 0.034 | CYP2D6-substrate: | 0.106 |
CYP3A4-inhibitor: | 0.022 | CYP3A4-substrate: | 0.096 |
Clearance (CL): | 3.667 | Half-life (T1/2): | 0.951 |
hERG Blockers: | 0.059 | Human Hepatotoxicity (H-HT): | 0.222 |
Drug-inuced Liver Injury (DILI): | 0.86 | AMES Toxicity: | 0.139 |
Rat Oral Acute Toxicity: | 0.408 | Maximum Recommended Daily Dose: | 0.01 |
Skin Sensitization: | 0.117 | Carcinogencity: | 0.593 |
Eye Corrosion: | 0.054 | Eye Irritation: | 0.935 |
Respiratory Toxicity: | 0.035 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002334 | ![]() |
0.550 | D0GY5Z | ![]() |
0.321 | ||
ENC005611 | ![]() |
0.531 | D0G4JI | ![]() |
0.263 | ||
ENC002433 | ![]() |
0.488 | D01ZEC | ![]() |
0.260 | ||
ENC004766 | ![]() |
0.458 | D01PLN | ![]() |
0.259 | ||
ENC005612 | ![]() |
0.364 | D02AQY | ![]() |
0.259 | ||
ENC005024 | ![]() |
0.346 | D07WZH | ![]() |
0.244 | ||
ENC003372 | ![]() |
0.327 | D01DSP | ![]() |
0.242 | ||
ENC006096 | ![]() |
0.321 | D0N1FS | ![]() |
0.227 | ||
ENC000073 | ![]() |
0.321 | D06NVJ | ![]() |
0.224 | ||
ENC004157 | ![]() |
0.317 | D06XGW | ![]() |
0.224 |