![]() |
Name |
5-(Hydroxymethyl)furan-3-carboxylic acid
|
Molecular Formula | C6H6O4 | |
IUPAC Name* |
5-(hydroxymethyl)furan-3-carboxylic acid
|
|
SMILES |
C1=C(OC=C1C(=O)O)CO
|
|
InChI |
InChI=1S/C6H6O4/c7-2-5-1-4(3-10-5)6(8)9/h1,3,7H,2H2,(H,8,9)
|
|
InChIKey |
ZEACFIAQNKKVPN-UHFFFAOYSA-N
|
|
Synonyms |
5-(Hydroxymethyl)furan-3-carboxylic acid; 246178-75-6; 5-hydroxymethylfuran-3-carboxylic acid; SCHEMBL3124525; DTXSID80572634; ZINC14490206; AKOS011551079; AT17501; 5-(Hydroxymethyl)furan-3-carboxylicacid; 2-(Hydroxymethyl)furan-4-carboxylic acid; CS-0309020; EN300-152046; Z970074936
|
|
CAS | 246178-75-6 | |
PubChem CID | 15422126 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 142.11 | ALogp: | -0.3 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 70.7 | Aromatic Rings: | 1 |
Heavy Atoms: | 10 | QED Weighted: | 0.642 |
Caco-2 Permeability: | -5.324 | MDCK Permeability: | 0.00021550 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.072 |
Human Intestinal Absorption (HIA): | 0.039 | 20% Bioavailability (F20%): | 0.019 |
30% Bioavailability (F30%): | 0.873 |
Blood-Brain-Barrier Penetration (BBB): | 0.315 | Plasma Protein Binding (PPB): | 49.70% |
Volume Distribution (VD): | 0.261 | Fu: | 69.13% |
CYP1A2-inhibitor: | 0.025 | CYP1A2-substrate: | 0.074 |
CYP2C19-inhibitor: | 0.026 | CYP2C19-substrate: | 0.044 |
CYP2C9-inhibitor: | 0.013 | CYP2C9-substrate: | 0.07 |
CYP2D6-inhibitor: | 0.008 | CYP2D6-substrate: | 0.131 |
CYP3A4-inhibitor: | 0.017 | CYP3A4-substrate: | 0.052 |
Clearance (CL): | 5.175 | Half-life (T1/2): | 0.953 |
hERG Blockers: | 0.027 | Human Hepatotoxicity (H-HT): | 0.45 |
Drug-inuced Liver Injury (DILI): | 0.764 | AMES Toxicity: | 0.014 |
Rat Oral Acute Toxicity: | 0.217 | Maximum Recommended Daily Dose: | 0.008 |
Skin Sensitization: | 0.133 | Carcinogencity: | 0.11 |
Eye Corrosion: | 0.006 | Eye Irritation: | 0.969 |
Respiratory Toxicity: | 0.065 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003614 | ![]() |
0.550 | D0C4YC | ![]() |
0.273 | ||
ENC002433 | ![]() |
0.514 | D01WJL | ![]() |
0.273 | ||
ENC000101 | ![]() |
0.500 | D06NVJ | ![]() |
0.268 | ||
ENC000748 | ![]() |
0.459 | D07HBX | ![]() |
0.256 | ||
ENC006095 | ![]() |
0.425 | D08HVR | ![]() |
0.231 | ||
ENC005612 | ![]() |
0.396 | D02UDJ | ![]() |
0.222 | ||
ENC002506 | ![]() |
0.350 | D0BA6T | ![]() |
0.222 | ||
ENC000002 | ![]() |
0.333 | D0S1NZ | ![]() |
0.217 | ||
ENC003873 | ![]() |
0.319 | D0PQ3G | ![]() |
0.217 | ||
ENC000029 | ![]() |
0.318 | D0EP8X | ![]() |
0.216 |