![]() |
Name |
7-O-acetyl kojic acid
|
Molecular Formula | C9H10O4 | |
IUPAC Name* |
(5-hydroxy-4-methylidenepyran-2-yl)methylacetate
|
|
SMILES |
C=C1C=C(COC(C)=O)OC=C1O
|
|
InChI |
InChI=1S/C9H10O4/c1-6-3-8(4-12-7(2)10)13-5-9(6)11/h3,5,11H,1,4H2,2H3
|
|
InChIKey |
VDEDPTCVSKVSML-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 182.17 | ALogp: | 1.4 |
HBD: | 1 | HBA: | 4 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 55.8 | Aromatic Rings: | 1 |
Heavy Atoms: | 13 | QED Weighted: | 0.663 |
Caco-2 Permeability: | -4.515 | MDCK Permeability: | 0.00006540 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.028 | 20% Bioavailability (F20%): | 0.542 |
30% Bioavailability (F30%): | 0.027 |
Blood-Brain-Barrier Penetration (BBB): | 0.949 | Plasma Protein Binding (PPB): | 57.88% |
Volume Distribution (VD): | 0.926 | Fu: | 64.62% |
CYP1A2-inhibitor: | 0.437 | CYP1A2-substrate: | 0.099 |
CYP2C19-inhibitor: | 0.091 | CYP2C19-substrate: | 0.283 |
CYP2C9-inhibitor: | 0.022 | CYP2C9-substrate: | 0.078 |
CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.214 |
CYP3A4-inhibitor: | 0.018 | CYP3A4-substrate: | 0.244 |
Clearance (CL): | 5.713 | Half-life (T1/2): | 0.92 |
hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.905 |
Drug-inuced Liver Injury (DILI): | 0.968 | AMES Toxicity: | 0.984 |
Rat Oral Acute Toxicity: | 0.944 | Maximum Recommended Daily Dose: | 0.317 |
Skin Sensitization: | 0.871 | Carcinogencity: | 0.742 |
Eye Corrosion: | 0.918 | Eye Irritation: | 0.91 |
Respiratory Toxicity: | 0.897 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004766 | ![]() |
0.400 | D0U0OT | ![]() |
0.210 | ||
ENC003614 | ![]() |
0.346 | D0Y6KO | ![]() |
0.209 | ||
ENC005611 | ![]() |
0.339 | D0GY5Z | ![]() |
0.207 | ||
ENC000308 | ![]() |
0.294 | D0U5QK | ![]() |
0.204 | ||
ENC003374 | ![]() |
0.291 | D01PLN | ![]() |
0.202 | ||
ENC001422 | ![]() |
0.291 | D0Q9HF | ![]() |
0.200 | ||
ENC004303 | ![]() |
0.290 | D01ZEC | ![]() |
0.198 | ||
ENC005903 | ![]() |
0.278 | D0BA6T | ![]() |
0.194 | ||
ENC006096 | ![]() |
0.273 | D0Q8ZX | ![]() |
0.193 | ||
ENC000377 | ![]() |
0.262 | D07WZH | ![]() |
0.191 |