|
Name |
[(1R,2R,4S,7R,9R,10R,11S,12S)-11-acetyloxy-2-(acetyloxymethyl)-10-hydroxy-1,5-dimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-4-yl] pentanoate
|
| Molecular Formula | C24H34O9 | |
| IUPAC Name* |
[(1R,2R,4S,7R,9R,10R,11S,12S)-11-acetyloxy-2-(acetyloxymethyl)-10-hydroxy-1,5-dimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-4-yl] pentanoate
|
|
| SMILES |
CCCCC(=O)O[C@H]1C[C@]2([C@@H](C=C1C)O[C@@H]3[C@@H]([C@H]([C@@]2([C@]34CO4)C)OC(=O)C)O)COC(=O)C
|
|
| InChI |
InChI=1S/C24H34O9/c1-6-7-8-18(27)32-16-10-23(11-29-14(3)25)17(9-13(16)2)33-21-19(28)20(31-15(4)26)22(23,5)24(21)12-30-24/h9,16-17,19-21,28H,6-8,10-12H2,1-5H3/t16-,17+,19+,20+,21+,22-,23+,24-/m0/s1
|
|
| InChIKey |
QXHICULSTMOREA-QFSIENHESA-N
|
|
| Synonyms |
8-n-Pentanoylneosolaniol
|
|
| CAS | NA | |
| PubChem CID | 139583257 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 466.5 | ALogp: | 1.0 |
| HBD: | 1 | HBA: | 9 |
| Rotatable Bonds: | 10 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 121.0 | Aromatic Rings: | 4 |
| Heavy Atoms: | 33 | QED Weighted: | 0.261 |
| Caco-2 Permeability: | -5.277 | MDCK Permeability: | 0.00006800 |
| Pgp-inhibitor: | 0.898 | Pgp-substrate: | 0.998 |
| Human Intestinal Absorption (HIA): | 0.036 | 20% Bioavailability (F20%): | 0.397 |
| 30% Bioavailability (F30%): | 0.913 |
| Blood-Brain-Barrier Penetration (BBB): | 0.337 | Plasma Protein Binding (PPB): | 51.61% |
| Volume Distribution (VD): | 1.165 | Fu: | 30.87% |
| CYP1A2-inhibitor: | 0.026 | CYP1A2-substrate: | 0.093 |
| CYP2C19-inhibitor: | 0.074 | CYP2C19-substrate: | 0.608 |
| CYP2C9-inhibitor: | 0.102 | CYP2C9-substrate: | 0.034 |
| CYP2D6-inhibitor: | 0.03 | CYP2D6-substrate: | 0.076 |
| CYP3A4-inhibitor: | 0.568 | CYP3A4-substrate: | 0.376 |
| Clearance (CL): | 3.088 | Half-life (T1/2): | 0.755 |
| hERG Blockers: | 0.114 | Human Hepatotoxicity (H-HT): | 0.747 |
| Drug-inuced Liver Injury (DILI): | 0.869 | AMES Toxicity: | 0.874 |
| Rat Oral Acute Toxicity: | 0.316 | Maximum Recommended Daily Dose: | 0.299 |
| Skin Sensitization: | 0.362 | Carcinogencity: | 0.06 |
| Eye Corrosion: | 0.004 | Eye Irritation: | 0.026 |
| Respiratory Toxicity: | 0.27 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003278 | ![]() |
0.870 | D0L2UN | ![]() |
0.286 | ||
| ENC002259 | ![]() |
0.817 | D01ZOG | ![]() |
0.283 | ||
| ENC001179 | ![]() |
0.806 | D0H2MO | ![]() |
0.278 | ||
| ENC003104 | ![]() |
0.776 | D03SXE | ![]() |
0.275 | ||
| ENC005516 | ![]() |
0.733 | D0G7KJ | ![]() |
0.273 | ||
| ENC005517 | ![]() |
0.720 | D0X2LV | ![]() |
0.268 | ||
| ENC003086 | ![]() |
0.695 | D09SIK | ![]() |
0.262 | ||
| ENC005586 | ![]() |
0.609 | D0OL7F | ![]() |
0.262 | ||
| ENC005587 | ![]() |
0.451 | D08BDT | ![]() |
0.255 | ||
| ENC005782 | ![]() |
0.320 | D00AEQ | ![]() |
0.250 | ||