![]() |
Name |
Solaniol (sesquiterpene)
|
Molecular Formula | C19H26O8 | |
IUPAC Name* |
[(4R,10R,11S)-11-acetyloxy-4,10-dihydroxy-1,5-dimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-2-yl]methyl acetate
|
|
SMILES |
CC1=CC2C(C[C@H]1O)(C3([C@@H]([C@H](C(C34CO4)O2)O)OC(=O)C)C)COC(=O)C
|
|
InChI |
InChI=1S/C19H26O8/c1-9-5-13-18(6-12(9)22,7-24-10(2)20)17(4)15(26-11(3)21)14(23)16(27-13)19(17)8-25-19/h5,12-16,22-23H,6-8H2,1-4H3/t12-,13?,14-,15-,16?,17?,18?,19?/m1/s1
|
|
InChIKey |
TVZHDVCTOCZDNE-DIIGPTBUSA-N
|
|
Synonyms |
Neosolaniol; Solaniol; Solaniol (sesquiterpene); 4-.beta.,15-Diacetoxy-3-.alpha.,8-.alpha.-dihydroxy-12,13-epoxytrichothec-9-ene; Trichothec-9-ene, 12,13-epoxy-4-.beta.,15-diacetoxy-3-.alpha.,8-.alpha.-dihydroxy-; Trichothec-9-ene-3-.alpha.,4-.beta.,8-.alpha.,15-tetrol, 12,13-epoxy-, 4,15-diacetate
|
|
CAS | 36519-25-2 | |
PubChem CID | 91746574 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 382.4 | ALogp: | -0.9 |
HBD: | 2 | HBA: | 8 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 115.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 27 | QED Weighted: | 0.412 |
Caco-2 Permeability: | -5.377 | MDCK Permeability: | 0.00006120 |
Pgp-inhibitor: | 0.106 | Pgp-substrate: | 0.997 |
Human Intestinal Absorption (HIA): | 0.905 | 20% Bioavailability (F20%): | 0.857 |
30% Bioavailability (F30%): | 0.967 |
Blood-Brain-Barrier Penetration (BBB): | 0.155 | Plasma Protein Binding (PPB): | 24.92% |
Volume Distribution (VD): | 0.758 | Fu: | 66.19% |
CYP1A2-inhibitor: | 0.012 | CYP1A2-substrate: | 0.098 |
CYP2C19-inhibitor: | 0.015 | CYP2C19-substrate: | 0.751 |
CYP2C9-inhibitor: | 0.005 | CYP2C9-substrate: | 0.054 |
CYP2D6-inhibitor: | 0.011 | CYP2D6-substrate: | 0.138 |
CYP3A4-inhibitor: | 0.064 | CYP3A4-substrate: | 0.303 |
Clearance (CL): | 2.396 | Half-life (T1/2): | 0.225 |
hERG Blockers: | 0.016 | Human Hepatotoxicity (H-HT): | 0.578 |
Drug-inuced Liver Injury (DILI): | 0.423 | AMES Toxicity: | 0.276 |
Rat Oral Acute Toxicity: | 0.953 | Maximum Recommended Daily Dose: | 0.457 |
Skin Sensitization: | 0.056 | Carcinogencity: | 0.099 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.016 |
Respiratory Toxicity: | 0.318 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002259 | ![]() |
0.767 | D09WYX | ![]() |
0.270 | ||
ENC005517 | ![]() |
0.761 | D0G7KJ | ![]() |
0.269 | ||
ENC003278 | ![]() |
0.742 | D08BDT | ![]() |
0.260 | ||
ENC005516 | ![]() |
0.736 | D03ZZK | ![]() |
0.258 | ||
ENC003104 | ![]() |
0.725 | D0H2MO | ![]() |
0.256 | ||
ENC001179 | ![]() |
0.702 | D0E9KA | ![]() |
0.252 | ||
ENC003580 | ![]() |
0.695 | D0R2KY | ![]() |
0.250 | ||
ENC005586 | ![]() |
0.569 | D0X7XG | ![]() |
0.248 | ||
ENC005587 | ![]() |
0.391 | D09SIK | ![]() |
0.246 | ||
ENC003277 | ![]() |
0.358 | D0OL7F | ![]() |
0.246 |