![]() |
Name |
Insariotoxin
|
Molecular Formula | C24H34O9 | |
IUPAC Name* |
[11-acetyloxy-2-(acetyloxymethyl)-10-hydroxy-1,5-dimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-4-yl] 3-methylbutanoate
|
|
SMILES |
CC1=CC2C(CC1OC(=O)CC(C)C)(C3(C(C(C(C34CO4)O2)O)OC(=O)C)C)COC(=O)C
|
|
InChI |
InChI=1S/C24H34O9/c1-12(2)7-18(27)32-16-9-23(10-29-14(4)25)17(8-13(16)3)33-21-19(28)20(31-15(5)26)22(23,6)24(21)11-30-24/h8,12,16-17,19-21,28H,7,9-11H2,1-6H3
|
|
InChIKey |
BXFOFFBJRFZBQZ-UHFFFAOYSA-N
|
|
Synonyms |
T-2 TOXIN; MLS002703014; SMR001566822; Insariotoxin; T-2 mycotoxin; Fusariotoxin T 2; T 2 Toxin; Toxin T 2; MYCOTOXIN T2; 8-(3-Methylbutyryloxy)diacetoxyscirpenol; 21259-20-1; SCHEMBL158370; cid_529495; CHEMBL1703795; BDBM93500; DTXSID20860264; Neosolaniol 8-(3-methylbutanoate); BCP24080; 8-(3-Methylbutyryloxy)-diacetoxy-Scirpenol; DB-045522; FT-0630470; T 2 Toxin;T2 Toxin;Insariotoxin;Fusariotoxin T-2;Mycotoxin T-2; 4,15-Bis(acetyloxy)-3-hydroxy-12,13-epoxytrichothec-9-en-8-yl 3-methylbutanoate
|
|
CAS | 21259-20-1 | |
PubChem CID | 529495 | |
ChEMBL ID | CHEMBL1703795 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 466.5 | ALogp: | 0.9 |
HBD: | 1 | HBA: | 9 |
Rotatable Bonds: | 9 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 121.0 | Aromatic Rings: | 4 |
Heavy Atoms: | 33 | QED Weighted: | 0.272 |
Caco-2 Permeability: | -5.251 | MDCK Permeability: | 0.00005440 |
Pgp-inhibitor: | 0.986 | Pgp-substrate: | 0.991 |
Human Intestinal Absorption (HIA): | 0.8 | 20% Bioavailability (F20%): | 0.182 |
30% Bioavailability (F30%): | 0.925 |
Blood-Brain-Barrier Penetration (BBB): | 0.332 | Plasma Protein Binding (PPB): | 38.34% |
Volume Distribution (VD): | 0.869 | Fu: | 46.67% |
CYP1A2-inhibitor: | 0.01 | CYP1A2-substrate: | 0.082 |
CYP2C19-inhibitor: | 0.02 | CYP2C19-substrate: | 0.766 |
CYP2C9-inhibitor: | 0.034 | CYP2C9-substrate: | 0.049 |
CYP2D6-inhibitor: | 0.01 | CYP2D6-substrate: | 0.102 |
CYP3A4-inhibitor: | 0.278 | CYP3A4-substrate: | 0.436 |
Clearance (CL): | 5.164 | Half-life (T1/2): | 0.126 |
hERG Blockers: | 0.006 | Human Hepatotoxicity (H-HT): | 0.608 |
Drug-inuced Liver Injury (DILI): | 0.785 | AMES Toxicity: | 0.159 |
Rat Oral Acute Toxicity: | 0.991 | Maximum Recommended Daily Dose: | 0.029 |
Skin Sensitization: | 0.027 | Carcinogencity: | 0.181 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.013 |
Respiratory Toxicity: | 0.04 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003104 | ![]() |
0.860 | D0G7KJ | ![]() |
0.275 | ||
ENC003278 | ![]() |
0.859 | D0H2MO | ![]() |
0.271 | ||
ENC002259 | ![]() |
0.826 | D0L2UN | ![]() |
0.269 | ||
ENC003580 | ![]() |
0.806 | D0X1WJ | ![]() |
0.264 | ||
ENC003086 | ![]() |
0.702 | D09SIK | ![]() |
0.264 | ||
ENC005517 | ![]() |
0.693 | D0OL7F | ![]() |
0.264 | ||
ENC005516 | ![]() |
0.673 | D08BDT | ![]() |
0.257 | ||
ENC005586 | ![]() |
0.600 | D01ZOG | ![]() |
0.250 | ||
ENC005587 | ![]() |
0.408 | D09WYX | ![]() |
0.248 | ||
ENC005782 | ![]() |
0.322 | D0X7XG | ![]() |
0.247 |