![]() |
Name |
2-(4-hydroxybenzyl)quinazolin-4(3H)-one
|
Molecular Formula | C15H12N2O2 | |
IUPAC Name* |
2-[(4-hydroxyphenyl)methyl]-3H-quinazolin-4-one
|
|
SMILES |
C1=CC=C2C(=C1)C(=O)NC(=N2)CC3=CC=C(C=C3)O
|
|
InChI |
InChI=1S/C15H12N2O2/c18-11-7-5-10(6-8-11)9-14-16-13-4-2-1-3-12(13)15(19)17-14/h1-8,18H,9H2,(H,16,17,19)
|
|
InChIKey |
MVWHKEGFSBSUSY-UHFFFAOYSA-N
|
|
Synonyms |
2-(4-hydroxybenzyl)quinazolin-4(3H)-one; CHEBI:68112; CHEMBL1669195; DTXSID201242051; ZINC48603432; AKOS034523849; CCG-331030; 2-(4-Hydroxybenzyl)quinazoline-4(3H)-one; 2-[(4-Hydroxyphenyl)methyl]-4(3H)-quinazolinone; Q27136604; Z666586720; 1260613-04-4
|
|
CAS | 1260613-04-4 | |
PubChem CID | 136026468 | |
ChEMBL ID | CHEMBL1669195 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 252.27 | ALogp: | 1.9 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 61.7 | Aromatic Rings: | 3 |
Heavy Atoms: | 19 | QED Weighted: | 0.737 |
Caco-2 Permeability: | -4.81 | MDCK Permeability: | 0.00002240 |
Pgp-inhibitor: | 0.021 | Pgp-substrate: | 0.009 |
Human Intestinal Absorption (HIA): | 0.019 | 20% Bioavailability (F20%): | 0.817 |
30% Bioavailability (F30%): | 0.031 |
Blood-Brain-Barrier Penetration (BBB): | 0.064 | Plasma Protein Binding (PPB): | 96.04% |
Volume Distribution (VD): | 0.423 | Fu: | 3.93% |
CYP1A2-inhibitor: | 0.875 | CYP1A2-substrate: | 0.256 |
CYP2C19-inhibitor: | 0.881 | CYP2C19-substrate: | 0.063 |
CYP2C9-inhibitor: | 0.752 | CYP2C9-substrate: | 0.144 |
CYP2D6-inhibitor: | 0.624 | CYP2D6-substrate: | 0.164 |
CYP3A4-inhibitor: | 0.355 | CYP3A4-substrate: | 0.466 |
Clearance (CL): | 6.211 | Half-life (T1/2): | 0.865 |
hERG Blockers: | 0.129 | Human Hepatotoxicity (H-HT): | 0.29 |
Drug-inuced Liver Injury (DILI): | 0.956 | AMES Toxicity: | 0.441 |
Rat Oral Acute Toxicity: | 0.686 | Maximum Recommended Daily Dose: | 0.08 |
Skin Sensitization: | 0.117 | Carcinogencity: | 0.29 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.122 |
Respiratory Toxicity: | 0.582 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004931 | ![]() |
0.537 | D0H6TP | ![]() |
0.414 | ||
ENC001911 | ![]() |
0.429 | D0Y7EM | ![]() |
0.365 | ||
ENC002149 | ![]() |
0.424 | D00JVR | ![]() |
0.357 | ||
ENC000858 | ![]() |
0.416 | D0E3SH | ![]() |
0.354 | ||
ENC003593 | ![]() |
0.414 | D04VKS | ![]() |
0.353 | ||
ENC001400 | ![]() |
0.410 | D06ZPS | ![]() |
0.352 | ||
ENC003571 | ![]() |
0.410 | D0S2BV | ![]() |
0.347 | ||
ENC002970 | ![]() |
0.405 | D0QV5T | ![]() |
0.337 | ||
ENC005446 | ![]() |
0.400 | D0YB1G | ![]() |
0.326 | ||
ENC005445 | ![]() |
0.400 | D00LFB | ![]() |
0.326 |