![]() |
Name |
3-(4-Hydroxyphenyl)-N-benzylpropionamide
|
Molecular Formula | C16H17NO2 | |
IUPAC Name* |
N-benzyl-3-(4-hydroxyphenyl)propanamide
|
|
SMILES |
C1=CC=C(C=C1)CNC(=O)CCC2=CC=C(C=C2)O
|
|
InChI |
InChI=1S/C16H17NO2/c18-15-9-6-13(7-10-15)8-11-16(19)17-12-14-4-2-1-3-5-14/h1-7,9-10,18H,8,11-12H2,(H,17,19)
|
|
InChIKey |
OSPJHCUBEDDXIQ-UHFFFAOYSA-N
|
|
Synonyms |
3-(4-Hydroxyphenyl)-N-benzylpropionamide; 74454-78-7; N-Benzyl-3-(4-hydroxyphenyl)propanamide; Hypoxypropanamide; SCHEMBL1894742; Benzenemethanamine, N-[[[4-hydroxyphenyl]ethyl]carbonyl]-; DTXSID20347348; ZINC404028; 3-(4-Hydroxyphenyl)-N-benzyl-propionamide; N-Benzyl-3-(4-hydroxyphenyl)propanamide #; N-benzyl-3-(4-hydroxy-phenyl)-propionamide; 3-(4-Hydroxyphenyl)-N-benzylpropionamide, 96%; 3-(4-HYDROXYPHENYL)N-BENZYLPROPIONAMIDE&
|
|
CAS | 74454-78-7 | |
PubChem CID | 620434 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 255.31 | ALogp: | 2.6 |
HBD: | 2 | HBA: | 2 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 49.3 | Aromatic Rings: | 2 |
Heavy Atoms: | 19 | QED Weighted: | 0.86 |
Caco-2 Permeability: | -4.6 | MDCK Permeability: | 0.00001880 |
Pgp-inhibitor: | 0.01 | Pgp-substrate: | 0.045 |
Human Intestinal Absorption (HIA): | 0.103 | 20% Bioavailability (F20%): | 0.993 |
30% Bioavailability (F30%): | 0.963 |
Blood-Brain-Barrier Penetration (BBB): | 0.369 | Plasma Protein Binding (PPB): | 94.69% |
Volume Distribution (VD): | 0.773 | Fu: | 5.65% |
CYP1A2-inhibitor: | 0.918 | CYP1A2-substrate: | 0.109 |
CYP2C19-inhibitor: | 0.945 | CYP2C19-substrate: | 0.241 |
CYP2C9-inhibitor: | 0.6 | CYP2C9-substrate: | 0.685 |
CYP2D6-inhibitor: | 0.865 | CYP2D6-substrate: | 0.865 |
CYP3A4-inhibitor: | 0.526 | CYP3A4-substrate: | 0.204 |
Clearance (CL): | 13.553 | Half-life (T1/2): | 0.905 |
hERG Blockers: | 0.386 | Human Hepatotoxicity (H-HT): | 0.19 |
Drug-inuced Liver Injury (DILI): | 0.026 | AMES Toxicity: | 0.134 |
Rat Oral Acute Toxicity: | 0.059 | Maximum Recommended Daily Dose: | 0.049 |
Skin Sensitization: | 0.714 | Carcinogencity: | 0.084 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.1 |
Respiratory Toxicity: | 0.026 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000908 | ![]() |
0.500 | D00DZN | ![]() |
0.533 | ||
ENC000209 | ![]() |
0.486 | D0H6TP | ![]() |
0.523 | ||
ENC002149 | ![]() |
0.476 | D0Y7EM | ![]() |
0.464 | ||
ENC003593 | ![]() |
0.464 | D04XGT | ![]() |
0.416 | ||
ENC000004 | ![]() |
0.458 | D0J2KV | ![]() |
0.411 | ||
ENC005600 | ![]() |
0.455 | D0P2GK | ![]() |
0.406 | ||
ENC002602 | ![]() |
0.455 | D0A8XN | ![]() |
0.402 | ||
ENC000870 | ![]() |
0.444 | D06LHG | ![]() |
0.397 | ||
ENC000779 | ![]() |
0.435 | D0X5UN | ![]() |
0.388 | ||
ENC000801 | ![]() |
0.435 | D06ZPS | ![]() |
0.382 |