![]() |
Name |
2-chloro-7,9-dihydroxy-3-methoxy-1-methyl-6H-benzo[c]chromen-6-one
|
Molecular Formula | C15H11ClO5 | |
IUPAC Name* |
2-chloro-7,9-dihydroxy-3-methoxy-1-methylbenzo[c]chromen-6-one
|
|
SMILES |
CC1=C2C(=CC(=C1Cl)OC)OC(=O)C3=C2C=C(C=C3O)O
|
|
InChI |
InChI=1S/C15H11ClO5/c1-6-12-8-3-7(17)4-9(18)13(8)15(19)21-10(12)5-11(20-2)14(6)16/h3-5,17-18H,1-2H3
|
|
InChIKey |
SQHXETAXRBEYRI-UHFFFAOYSA-N
|
|
Synonyms |
hyalodendriol C; CHEBI:141333; 2-chloro-7,9-dihydroxy-3-methoxy-1-methyl-6H-benzo[c]chromen-6-one
|
|
CAS | NA | |
PubChem CID | 135563653 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 306.7 | ALogp: | 3.8 |
HBD: | 2 | HBA: | 5 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 76.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 21 | QED Weighted: | 0.523 |
Caco-2 Permeability: | -4.898 | MDCK Permeability: | 0.00001140 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.736 |
Human Intestinal Absorption (HIA): | 0.044 | 20% Bioavailability (F20%): | 0.011 |
30% Bioavailability (F30%): | 0.827 |
Blood-Brain-Barrier Penetration (BBB): | 0.015 | Plasma Protein Binding (PPB): | 97.30% |
Volume Distribution (VD): | 0.565 | Fu: | 5.55% |
CYP1A2-inhibitor: | 0.966 | CYP1A2-substrate: | 0.931 |
CYP2C19-inhibitor: | 0.63 | CYP2C19-substrate: | 0.079 |
CYP2C9-inhibitor: | 0.766 | CYP2C9-substrate: | 0.949 |
CYP2D6-inhibitor: | 0.73 | CYP2D6-substrate: | 0.637 |
CYP3A4-inhibitor: | 0.468 | CYP3A4-substrate: | 0.114 |
Clearance (CL): | 6.6 | Half-life (T1/2): | 0.597 |
hERG Blockers: | 0.015 | Human Hepatotoxicity (H-HT): | 0.155 |
Drug-inuced Liver Injury (DILI): | 0.959 | AMES Toxicity: | 0.28 |
Rat Oral Acute Toxicity: | 0.053 | Maximum Recommended Daily Dose: | 0.924 |
Skin Sensitization: | 0.82 | Carcinogencity: | 0.037 |
Eye Corrosion: | 0.618 | Eye Irritation: | 0.972 |
Respiratory Toxicity: | 0.459 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003471 | ![]() |
0.762 | D06GCK | ![]() |
0.385 | ||
ENC002692 | ![]() |
0.727 | D0K8KX | ![]() |
0.376 | ||
ENC004844 | ![]() |
0.657 | D04AIT | ![]() |
0.369 | ||
ENC005649 | ![]() |
0.629 | D07MGA | ![]() |
0.356 | ||
ENC001773 | ![]() |
0.623 | D0FA2O | ![]() |
0.284 | ||
ENC001653 | ![]() |
0.623 | D0G4KG | ![]() |
0.279 | ||
ENC004846 | ![]() |
0.623 | D0AZ8C | ![]() |
0.270 | ||
ENC005361 | ![]() |
0.623 | D0C1SF | ![]() |
0.258 | ||
ENC005191 | ![]() |
0.623 | D0QD1G | ![]() |
0.248 | ||
ENC005808 | ![]() |
0.623 | D0W7JZ | ![]() |
0.244 |