|
Name |
Alternariol monomethyl ether
|
| Molecular Formula | C15H12O5 | |
| IUPAC Name* |
3,7-dihydroxy-9-methoxy-1-methylbenzo[c]chromen-6-one
|
|
| SMILES |
CC1=CC(=CC2=C1C3=C(C(=CC(=C3)OC)O)C(=O)O2)O
|
|
| InChI |
InChI=1S/C15H12O5/c1-7-3-8(16)4-12-13(7)10-5-9(19-2)6-11(17)14(10)15(18)20-12/h3-6,16-17H,1-2H3
|
|
| InChIKey |
LCSDQFNUYFTXMT-UHFFFAOYSA-N
|
|
| Synonyms |
Alternariol monomethyl ether; 23452-05-3; Djalonensone; 26894-49-5; Alternariol-9-methyl ether; Alternariol monomethylether; alternariol 5-O-methyl ether; 3,7-Dihydroxy-9-methoxy-1-methyl-6H-benzo[c]chromen-6-one; Alternariol methyl ether; 3,7-dihydroxy-9-methoxy-1-methylbenzo[c]chromen-6-one; 3,7-Dihydroxy-9-methoxy-1-methyl-6H-dibenzo(b,d)pyran-6-one; CHEMBL483526; Y79STA800H; 6H-DIBENZO(b,d)PYRAN-6-ONE, 3,7-DIHYDROXY-9-METHOXY-1-METHYL-; NSC638262; Alternariol monomethyl ether from Alternaria alternata (tenuis); CCRIS 2898; alternariol 9-methyl ether; BRN 0253553; UNII-Y79STA800H; 3,7-Dihydroxy-9-methoxy-1-methyl-6H-dibenzo[b,d]pyran-6-one; alternariol5-O-methylether; 5-18-04-00517 (Beilstein Handbook Reference); Alternariol 9-O-methyl ether; MLS004711973; Dexamfetamine-d3 Hydrochloride; MEGxm0_000058; DTXSID30178004; CHEBI:141315; ZINC5765088; BDBM50276157; MFCD00058532; Alternariol monomethyl ether_120111; AKOS027295171; 1ST7257; BS-1261; CS-W014579; HY-W013863; NSC-638262; 2-Biphenylcarboxylic acid, 2',3',4'-trihydroxy-5-methoxy-6'-methyl-, delta-lactone; 6H-Dibenzo[b,d]pyran-6-one, 3,7(3,9 or 7,9)-dihydroxy-9(7 or 3)-methoxy-1-methyl-; SMR003474896; FT-0661537; Alternariol-9-methyl ether, analytical standard; J-016590; Q27294342; 3,7-dihydroxy-9-methoxy-1-methyl-benzo[c]chromen-6-one; 3,7-Dihydroxy-9-methoxy-1-methyl-6H-benzo[c]chromen-6-one #
|
|
| CAS | 23452-05-3 | |
| PubChem CID | 5360741 | |
| ChEMBL ID | CHEMBL483526 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 272.25 | ALogp: | 3.2 |
| HBD: | 2 | HBA: | 5 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 76.0 | Aromatic Rings: | 3 |
| Heavy Atoms: | 20 | QED Weighted: | 0.523 |
| Caco-2 Permeability: | -4.951 | MDCK Permeability: | 0.00000918 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.99 |
| Human Intestinal Absorption (HIA): | 0.022 | 20% Bioavailability (F20%): | 0.023 |
| 30% Bioavailability (F30%): | 0.993 |
| Blood-Brain-Barrier Penetration (BBB): | 0.016 | Plasma Protein Binding (PPB): | 93.72% |
| Volume Distribution (VD): | 0.721 | Fu: | 9.28% |
| CYP1A2-inhibitor: | 0.986 | CYP1A2-substrate: | 0.921 |
| CYP2C19-inhibitor: | 0.496 | CYP2C19-substrate: | 0.081 |
| CYP2C9-inhibitor: | 0.618 | CYP2C9-substrate: | 0.953 |
| CYP2D6-inhibitor: | 0.766 | CYP2D6-substrate: | 0.887 |
| CYP3A4-inhibitor: | 0.498 | CYP3A4-substrate: | 0.104 |
| Clearance (CL): | 6.851 | Half-life (T1/2): | 0.629 |
| hERG Blockers: | 0.017 | Human Hepatotoxicity (H-HT): | 0.191 |
| Drug-inuced Liver Injury (DILI): | 0.954 | AMES Toxicity: | 0.376 |
| Rat Oral Acute Toxicity: | 0.052 | Maximum Recommended Daily Dose: | 0.913 |
| Skin Sensitization: | 0.87 | Carcinogencity: | 0.029 |
| Eye Corrosion: | 0.387 | Eye Irritation: | 0.978 |
| Respiratory Toxicity: | 0.362 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005808 | ![]() |
1.000 | D04AIT | ![]() |
0.413 | ||
| ENC004846 | ![]() |
1.000 | D0K8KX | ![]() |
0.386 | ||
| ENC005191 | ![]() |
1.000 | D06GCK | ![]() |
0.363 | ||
| ENC004845 | ![]() |
0.766 | D07MGA | ![]() |
0.333 | ||
| ENC003430 | ![]() |
0.766 | D0FA2O | ![]() |
0.291 | ||
| ENC001652 | ![]() |
0.754 | D0G4KG | ![]() |
0.286 | ||
| ENC001750 | ![]() |
0.746 | D04UTT | ![]() |
0.267 | ||
| ENC002692 | ![]() |
0.697 | D0AZ8C | ![]() |
0.254 | ||
| ENC002516 | ![]() |
0.672 | D0G5UB | ![]() |
0.250 | ||
| ENC002134 | ![]() |
0.643 | D02TJS | ![]() |
0.248 | ||