![]() |
Name |
5-chloro-6-O-methylnorlichexanthone
|
Molecular Formula | C15H11ClO5 | |
IUPAC Name* |
4-chloro-1,6-dihydroxy-3-methoxy-8-methylxanthen-9-one
|
|
SMILES |
COc1cc(O)c2c(=O)c3c(C)cc(O)cc3oc2c1Cl
|
|
InChI |
InChI=1S/C15H11ClO5/c1-6-3-7(17)4-9-11(6)14(19)12-8(18)5-10(20-2)13(16)15(12)21-9/h3-5,17-18H,1-2H3
|
|
InChIKey |
CZPDUDROBNWTDV-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 306.7 | ALogp: | 3.3 |
HBD: | 2 | HBA: | 5 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 79.9 | Aromatic Rings: | 3 |
Heavy Atoms: | 21 | QED Weighted: | 0.662 |
Caco-2 Permeability: | -4.857 | MDCK Permeability: | 0.00001250 |
Pgp-inhibitor: | 0.002 | Pgp-substrate: | 0.014 |
Human Intestinal Absorption (HIA): | 0.038 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.026 |
Blood-Brain-Barrier Penetration (BBB): | 0.02 | Plasma Protein Binding (PPB): | 96.16% |
Volume Distribution (VD): | 0.746 | Fu: | 5.98% |
CYP1A2-inhibitor: | 0.952 | CYP1A2-substrate: | 0.947 |
CYP2C19-inhibitor: | 0.669 | CYP2C19-substrate: | 0.071 |
CYP2C9-inhibitor: | 0.834 | CYP2C9-substrate: | 0.933 |
CYP2D6-inhibitor: | 0.586 | CYP2D6-substrate: | 0.645 |
CYP3A4-inhibitor: | 0.308 | CYP3A4-substrate: | 0.132 |
Clearance (CL): | 5.972 | Half-life (T1/2): | 0.647 |
hERG Blockers: | 0.005 | Human Hepatotoxicity (H-HT): | 0.152 |
Drug-inuced Liver Injury (DILI): | 0.961 | AMES Toxicity: | 0.557 |
Rat Oral Acute Toxicity: | 0.202 | Maximum Recommended Daily Dose: | 0.887 |
Skin Sensitization: | 0.691 | Carcinogencity: | 0.054 |
Eye Corrosion: | 0.052 | Eye Irritation: | 0.928 |
Respiratory Toxicity: | 0.725 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005648 | ![]() |
0.754 | D0K8KX | ![]() |
0.393 | ||
ENC003814 | ![]() |
0.649 | D06GCK | ![]() |
0.385 | ||
ENC001750 | ![]() |
0.647 | D04AIT | ![]() |
0.369 | ||
ENC003509 | ![]() |
0.629 | D07MGA | ![]() |
0.341 | ||
ENC002197 | ![]() |
0.605 | D0FA2O | ![]() |
0.284 | ||
ENC002018 | ![]() |
0.586 | D0G4KG | ![]() |
0.279 | ||
ENC005647 | ![]() |
0.583 | D0AZ8C | ![]() |
0.260 | ||
ENC001574 | ![]() |
0.580 | D0C1SF | ![]() |
0.258 | ||
ENC005808 | ![]() |
0.577 | D0QD1G | ![]() |
0.248 | ||
ENC005191 | ![]() |
0.577 | D0E9CD | ![]() |
0.243 |