![]() |
Name |
(3Z,6Z,10Z)-3,7,11-trimethyl-14-propan-2-ylcyclotetradeca-1,3,6,10-tetraene
|
Molecular Formula | C20H32 | |
IUPAC Name* |
(3Z,6Z,10Z)-3,7,11-trimethyl-14-propan-2-ylcyclotetradeca-1,3,6,10-tetraene
|
|
SMILES |
C/C/1=C/CC/C(=C\C/C=C(\C=CC(CC1)C(C)C)/C)/C
|
|
InChI |
InChI=1S/C20H32/c1-16(2)20-14-12-18(4)10-6-8-17(3)9-7-11-19(5)13-15-20/h8,10-12,14,16,20H,6-7,9,13,15H2,1-5H3/b14-12?,17-8-,18-10-,19-11-
|
|
InChIKey |
DMHADBQKVWXPPM-CZIVKHGLSA-N
|
|
Synonyms |
Cembrene; 1898-13-1
|
|
CAS | NA | |
PubChem CID | 134128866 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 272.5 | ALogp: | 6.0 |
HBD: | 0 | HBA: | 0 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 0.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 20 | QED Weighted: | 0.474 |
Caco-2 Permeability: | -4.579 | MDCK Permeability: | 0.00002430 |
Pgp-inhibitor: | 0.047 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.01 | 20% Bioavailability (F20%): | 0.979 |
30% Bioavailability (F30%): | 0.986 |
Blood-Brain-Barrier Penetration (BBB): | 0.546 | Plasma Protein Binding (PPB): | 99.71% |
Volume Distribution (VD): | 2.766 | Fu: | 1.51% |
CYP1A2-inhibitor: | 0.216 | CYP1A2-substrate: | 0.636 |
CYP2C19-inhibitor: | 0.409 | CYP2C19-substrate: | 0.925 |
CYP2C9-inhibitor: | 0.495 | CYP2C9-substrate: | 0.358 |
CYP2D6-inhibitor: | 0.564 | CYP2D6-substrate: | 0.845 |
CYP3A4-inhibitor: | 0.885 | CYP3A4-substrate: | 0.724 |
Clearance (CL): | 9.35 | Half-life (T1/2): | 0.792 |
hERG Blockers: | 0.068 | Human Hepatotoxicity (H-HT): | 0.919 |
Drug-inuced Liver Injury (DILI): | 0.014 | AMES Toxicity: | 0.02 |
Rat Oral Acute Toxicity: | 0.024 | Maximum Recommended Daily Dose: | 0.754 |
Skin Sensitization: | 0.935 | Carcinogencity: | 0.741 |
Eye Corrosion: | 0.006 | Eye Irritation: | 0.293 |
Respiratory Toxicity: | 0.905 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001809 | ![]() |
1.000 | D0WO8W | ![]() |
0.193 | ||
ENC003502 | ![]() |
0.420 | D01CKY | ![]() |
0.192 | ||
ENC002652 | ![]() |
0.391 | D06IXT | ![]() |
0.188 | ||
ENC000196 | ![]() |
0.390 | D06GIP | ![]() |
0.183 | ||
ENC001882 | ![]() |
0.385 | D0U3DU | ![]() |
0.183 | ||
ENC002974 | ![]() |
0.385 | D0C7JF | ![]() |
0.182 | ||
ENC003560 | ![]() |
0.385 | D09RHQ | ![]() |
0.181 | ||
ENC004376 | ![]() |
0.385 | D09PJX | ![]() |
0.178 | ||
ENC003150 | ![]() |
0.380 | D0P1FO | ![]() |
0.178 | ||
ENC003210 | ![]() |
0.356 | D06PSS | ![]() |
0.178 |