![]() |
Name |
[(3R,6R,7R)-3,7-dihydroxy-3-(3-hydroxypropyl)-7-methyl-8-oxo-1,4,5,6-tetrahydroisochromen-6-yl] 2,4-dihydroxy-6-methylbenzoate
|
Molecular Formula | C21H26O9 | |
IUPAC Name* |
[(3R,6R,7R)-3,7-dihydroxy-3-(3-hydroxypropyl)-7-methyl-8-oxo-1,4,5,6-tetrahydroisochromen-6-yl] 2,4-dihydroxy-6-methylbenzoate
|
|
SMILES |
CC1=CC(=CC(=C1C(=O)O[C@@H]2CC3=C(CO[C@@](C3)(CCCO)O)C(=O)[C@]2(C)O)O)O
|
|
InChI |
InChI=1S/C21H26O9/c1-11-6-13(23)8-15(24)17(11)19(26)30-16-7-12-9-21(28,4-3-5-22)29-10-14(12)18(25)20(16,2)27/h6,8,16,22-24,27-28H,3-5,7,9-10H2,1-2H3/t16-,20-,21-/m1/s1
|
|
InChIKey |
NTGQTBBYTOAJAQ-MAODMQOUSA-N
|
|
Synonyms |
Montagnuphilone E; CHEMBL4087913; J3.616.324K
|
|
CAS | NA | |
PubChem CID | 132992080 | |
ChEMBL ID | CHEMBL4087913 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 422.4 | ALogp: | 0.6 |
HBD: | 5 | HBA: | 9 |
Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 154.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 30 | QED Weighted: | 0.441 |
Caco-2 Permeability: | -5.778 | MDCK Permeability: | 0.00001290 |
Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.996 |
Human Intestinal Absorption (HIA): | 0.961 | 20% Bioavailability (F20%): | 1 |
30% Bioavailability (F30%): | 0.991 |
Blood-Brain-Barrier Penetration (BBB): | 0.263 | Plasma Protein Binding (PPB): | 68.48% |
Volume Distribution (VD): | 1.364 | Fu: | 31.59% |
CYP1A2-inhibitor: | 0.107 | CYP1A2-substrate: | 0.356 |
CYP2C19-inhibitor: | 0.03 | CYP2C19-substrate: | 0.063 |
CYP2C9-inhibitor: | 0.048 | CYP2C9-substrate: | 0.495 |
CYP2D6-inhibitor: | 0.011 | CYP2D6-substrate: | 0.088 |
CYP3A4-inhibitor: | 0.655 | CYP3A4-substrate: | 0.2 |
Clearance (CL): | 8.494 | Half-life (T1/2): | 0.818 |
hERG Blockers: | 0.012 | Human Hepatotoxicity (H-HT): | 0.071 |
Drug-inuced Liver Injury (DILI): | 0.936 | AMES Toxicity: | 0.07 |
Rat Oral Acute Toxicity: | 0.693 | Maximum Recommended Daily Dose: | 0.054 |
Skin Sensitization: | 0.047 | Carcinogencity: | 0.782 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.052 |
Respiratory Toxicity: | 0.754 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003451 | ![]() |
1.000 | D02GAC | ![]() |
0.254 | ||
ENC003449 | ![]() |
0.822 | D08NQZ | ![]() |
0.250 | ||
ENC003838 | ![]() |
0.822 | D0R6RC | ![]() |
0.246 | ||
ENC005503 | ![]() |
0.602 | D07MGA | ![]() |
0.246 | ||
ENC002211 | ![]() |
0.569 | D05AFR | ![]() |
0.243 | ||
ENC002726 | ![]() |
0.539 | D0J2NK | ![]() |
0.237 | ||
ENC003837 | ![]() |
0.528 | D04VEJ | ![]() |
0.233 | ||
ENC002132 | ![]() |
0.500 | D07VLY | ![]() |
0.222 | ||
ENC002131 | ![]() |
0.441 | D0C9XJ | ![]() |
0.222 | ||
ENC003224 | ![]() |
0.434 | D0L7AS | ![]() |
0.220 |