![]() |
Name |
rubiginosin A
|
Molecular Formula | C23H24O9 | |
IUPAC Name* |
[(6R,7R)-3-[(E)-3-acetyloxyprop-1-enyl]-7-hydroxy-7-methyl-8-oxo-5,6-dihydro-1H-isochromen-6-yl] 2,4-dihydroxy-6-methylbenzoate
|
|
SMILES |
CC1=CC(=CC(=C1C(=O)O[C@@H]2CC3=C(COC(=C3)/C=C/COC(=O)C)C(=O)[C@]2(C)O)O)O
|
|
InChI |
InChI=1S/C23H24O9/c1-12-7-15(25)10-18(26)20(12)22(28)32-19-9-14-8-16(5-4-6-30-13(2)24)31-11-17(14)21(27)23(19,3)29/h4-5,7-8,10,19,25-26,29H,6,9,11H2,1-3H3/b5-4+/t19-,23-/m1/s1
|
|
InChIKey |
ZDAMBVJOZXCGPS-PYDVXLROSA-N
|
|
Synonyms |
rubiginosin A; CHEMBL497262; ZDAMBVJOZXCGPS-PYDVXLROSA-; [(6R,7R)-3-[(E)-3-acetyloxyprop-1-enyl]-7-hydroxy-7-methyl-8-oxo-5,6-dihydro-1H-isochromen-6-yl] 2,4-dihydroxy-6-methylbenzoate
|
|
CAS | NA | |
PubChem CID | 11270720 | |
ChEMBL ID | CHEMBL497262 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 444.4 | ALogp: | 1.9 |
HBD: | 3 | HBA: | 9 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 140.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 32 | QED Weighted: | 0.585 |
Caco-2 Permeability: | -5.019 | MDCK Permeability: | 0.00001950 |
Pgp-inhibitor: | 0.007 | Pgp-substrate: | 0.081 |
Human Intestinal Absorption (HIA): | 0.261 | 20% Bioavailability (F20%): | 0.983 |
30% Bioavailability (F30%): | 0.932 |
Blood-Brain-Barrier Penetration (BBB): | 0.136 | Plasma Protein Binding (PPB): | 86.32% |
Volume Distribution (VD): | 0.873 | Fu: | 15.95% |
CYP1A2-inhibitor: | 0.957 | CYP1A2-substrate: | 0.118 |
CYP2C19-inhibitor: | 0.469 | CYP2C19-substrate: | 0.061 |
CYP2C9-inhibitor: | 0.715 | CYP2C9-substrate: | 0.841 |
CYP2D6-inhibitor: | 0.938 | CYP2D6-substrate: | 0.146 |
CYP3A4-inhibitor: | 0.837 | CYP3A4-substrate: | 0.204 |
Clearance (CL): | 2.977 | Half-life (T1/2): | 0.91 |
hERG Blockers: | 0.012 | Human Hepatotoxicity (H-HT): | 0.412 |
Drug-inuced Liver Injury (DILI): | 0.949 | AMES Toxicity: | 0.328 |
Rat Oral Acute Toxicity: | 0.263 | Maximum Recommended Daily Dose: | 0.952 |
Skin Sensitization: | 0.945 | Carcinogencity: | 0.863 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.708 |
Respiratory Toxicity: | 0.077 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002211 | ![]() |
0.804 | D07MGA | ![]() |
0.254 | ||
ENC002726 | ![]() |
0.791 | D0Q0PR | ![]() |
0.241 | ||
ENC003837 | ![]() |
0.787 | D08NQZ | ![]() |
0.239 | ||
ENC002131 | ![]() |
0.627 | D0R6RC | ![]() |
0.227 | ||
ENC003304 | ![]() |
0.615 | D0J2NK | ![]() |
0.227 | ||
ENC005503 | ![]() |
0.552 | D02GAC | ![]() |
0.226 | ||
ENC003839 | ![]() |
0.532 | D05AFR | ![]() |
0.226 | ||
ENC003838 | ![]() |
0.532 | D08LTU | ![]() |
0.225 | ||
ENC003449 | ![]() |
0.532 | D02CNR | ![]() |
0.224 | ||
ENC003448 | ![]() |
0.509 | D09WYX | ![]() |
0.224 |