![]() |
Name |
Entonaemin A
|
Molecular Formula | C21H22O8 | |
IUPAC Name* |
[(6R,7R)-7-hydroxy-3-[(E)-3-hydroxyprop-1-enyl]-7-methyl-8-oxo-5,6-dihydro-1H-isochromen-6-yl] 2,4-dihydroxy-6-methylbenzoate
|
|
SMILES |
CC1=CC(=CC(=C1C(=O)O[C@@H]2CC3=C(COC(=C3)/C=C/CO)C(=O)[C@]2(C)O)O)O
|
|
InChI |
InChI=1S/C21H22O8/c1-11-6-13(23)9-16(24)18(11)20(26)29-17-8-12-7-14(4-3-5-22)28-10-15(12)19(25)21(17,2)27/h3-4,6-7,9,17,22-24,27H,5,8,10H2,1-2H3/b4-3+/t17-,21-/m1/s1
|
|
InChIKey |
IJXINSBAHMLBBL-RIEYKTBPSA-N
|
|
Synonyms |
Entonaemin A; MLS005941365; SMR004614079
|
|
CAS | NA | |
PubChem CID | 12179192 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 402.4 | ALogp: | 1.4 |
HBD: | 4 | HBA: | 8 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 134.0 | Aromatic Rings: | 3 |
Heavy Atoms: | 29 | QED Weighted: | 0.562 |
Caco-2 Permeability: | -5.213 | MDCK Permeability: | 0.00001440 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.607 |
Human Intestinal Absorption (HIA): | 0.316 | 20% Bioavailability (F20%): | 0.964 |
30% Bioavailability (F30%): | 0.827 |
Blood-Brain-Barrier Penetration (BBB): | 0.22 | Plasma Protein Binding (PPB): | 87.82% |
Volume Distribution (VD): | 0.765 | Fu: | 15.12% |
CYP1A2-inhibitor: | 0.721 | CYP1A2-substrate: | 0.167 |
CYP2C19-inhibitor: | 0.098 | CYP2C19-substrate: | 0.06 |
CYP2C9-inhibitor: | 0.422 | CYP2C9-substrate: | 0.912 |
CYP2D6-inhibitor: | 0.643 | CYP2D6-substrate: | 0.136 |
CYP3A4-inhibitor: | 0.823 | CYP3A4-substrate: | 0.262 |
Clearance (CL): | 6.248 | Half-life (T1/2): | 0.894 |
hERG Blockers: | 0.016 | Human Hepatotoxicity (H-HT): | 0.914 |
Drug-inuced Liver Injury (DILI): | 0.935 | AMES Toxicity: | 0.294 |
Rat Oral Acute Toxicity: | 0.217 | Maximum Recommended Daily Dose: | 0.97 |
Skin Sensitization: | 0.794 | Carcinogencity: | 0.794 |
Eye Corrosion: | 0.007 | Eye Irritation: | 0.872 |
Respiratory Toxicity: | 0.177 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002726 | ![]() |
0.845 | D07MGA | ![]() |
0.273 | ||
ENC003837 | ![]() |
0.818 | D08NQZ | ![]() |
0.244 | ||
ENC002132 | ![]() |
0.804 | D02GAC | ![]() |
0.239 | ||
ENC002131 | ![]() |
0.775 | D04AIT | ![]() |
0.234 | ||
ENC003304 | ![]() |
0.633 | D0R6RC | ![]() |
0.231 | ||
ENC005503 | ![]() |
0.582 | D0J2NK | ![]() |
0.231 | ||
ENC003450 | ![]() |
0.569 | D0K8KX | ![]() |
0.230 | ||
ENC003451 | ![]() |
0.569 | D05AFR | ![]() |
0.230 | ||
ENC003838 | ![]() |
0.543 | D08LTU | ![]() |
0.230 | ||
ENC003449 | ![]() |
0.543 | D02PMO | ![]() |
0.222 |