NPs Basic Information
|
Name |
Spirobrocazine B
|
| Molecular Formula | C19H16N2O4S | |
| IUPAC Name* |
(3S,10aR)-6-hydroxy-10a-methylsulfanylspiro[2,10-dihydropyrazino[1,2-a]indole-3,2'-3H-1-benzofuran]-1,4-dione
|
|
| SMILES |
CS[C@@]12CC3=C(N1C(=O)[C@@]4(CC5=CC=CC=C5O4)NC2=O)C(=CC=C3)O
|
|
| InChI |
InChI=1S/C19H16N2O4S/c1-26-19-10-12-6-4-7-13(22)15(12)21(19)17(24)18(20-16(19)23)9-11-5-2-3-8-14(11)25-18/h2-8,22H,9-10H2,1H3,(H,20,23)/t18-,19+/m0/s1
|
|
| InChIKey |
QEJFLMXVVNWJQD-RBUKOAKNSA-N
|
|
| Synonyms |
Spirobrocazine B; J3.558.893K
|
|
| CAS | NA | |
| PubChem CID | 132600335 | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was collected from PubChem.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 368.4 | ALogp: | 2.4 |
| HBD: | 2 | HBA: | 5 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 104.0 | Aromatic Rings: | 5 |
| Heavy Atoms: | 26 | QED Weighted: | 0.808 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -5.134 | MDCK Permeability: | 0.00002740 |
| Pgp-inhibitor: | 0.008 | Pgp-substrate: | 0.002 |
| Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.004 |
| 30% Bioavailability (F30%): | 0.029 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.969 | Plasma Protein Binding (PPB): | 92.38% |
| Volume Distribution (VD): | 0.621 | Fu: | 7.13% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.264 | CYP1A2-substrate: | 0.375 |
| CYP2C19-inhibitor: | 0.935 | CYP2C19-substrate: | 0.913 |
| CYP2C9-inhibitor: | 0.908 | CYP2C9-substrate: | 0.913 |
| CYP2D6-inhibitor: | 0.224 | CYP2D6-substrate: | 0.232 |
| CYP3A4-inhibitor: | 0.9 | CYP3A4-substrate: | 0.955 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 13.858 | Half-life (T1/2): | 0.63 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.001 | Human Hepatotoxicity (H-HT): | 0.193 |
| Drug-inuced Liver Injury (DILI): | 0.979 | AMES Toxicity: | 0.053 |
| Rat Oral Acute Toxicity: | 0.754 | Maximum Recommended Daily Dose: | 0.033 |
| Skin Sensitization: | 0.435 | Carcinogencity: | 0.833 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
| Respiratory Toxicity: | 0.025 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003438 |  |
0.574 | D0QL3P |  |
0.280 | ||
| ENC003440 |  |
0.505 | D08EOD |  |
0.278 | ||
| ENC005510 |  |
0.432 | D0E4DW |  |
0.277 | ||
| ENC003035 |  |
0.339 | D08CCE |  |
0.276 | ||
| ENC003111 |  |
0.337 | D0DV3O |  |
0.275 | ||
| ENC003390 |  |
0.323 | D0H6QU |  |
0.272 | ||
| ENC001956 |  |
0.321 | D07RGW |  |
0.269 | ||
| ENC004650 |  |
0.320 | D08UMH |  |
0.268 | ||
| ENC000171 |  |
0.318 | D04WFD |  |
0.267 | ||
| ENC001985 |  |
0.315 | D01UTL |  |
0.267 | ||