![]() |
Name |
Spirobrocazine A
|
Molecular Formula | C19H18N2O4S | |
IUPAC Name* |
(3S,5aS,6S,10aR)-6-hydroxy-10a-methylsulfanylspiro[2,5a,6,10-tetrahydropyrazino[1,2-a]indole-3,2'-3H-1-benzofuran]-1,4-dione
|
|
SMILES |
CS[C@@]12CC3=CC=C[C@@H]([C@H]3N1C(=O)[C@@]4(CC5=CC=CC=C5O4)NC2=O)O
|
|
InChI |
InChI=1S/C19H18N2O4S/c1-26-19-10-12-6-4-7-13(22)15(12)21(19)17(24)18(20-16(19)23)9-11-5-2-3-8-14(11)25-18/h2-8,13,15,22H,9-10H2,1H3,(H,20,23)/t13-,15-,18-,19+/m0/s1
|
|
InChIKey |
QFWGYIKIPBTLBM-KNEBKQPDSA-N
|
|
Synonyms |
Spirobrocazine A; J3.558.892B
|
|
CAS | NA | |
PubChem CID | 132600334 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 370.4 | ALogp: | 1.1 |
HBD: | 2 | HBA: | 5 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 104.0 | Aromatic Rings: | 5 |
Heavy Atoms: | 26 | QED Weighted: | 0.781 |
Caco-2 Permeability: | -5.176 | MDCK Permeability: | 0.00002440 |
Pgp-inhibitor: | 0.076 | Pgp-substrate: | 0.008 |
Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.005 |
30% Bioavailability (F30%): | 0.042 |
Blood-Brain-Barrier Penetration (BBB): | 0.983 | Plasma Protein Binding (PPB): | 87.21% |
Volume Distribution (VD): | 1.047 | Fu: | 12.99% |
CYP1A2-inhibitor: | 0.02 | CYP1A2-substrate: | 0.098 |
CYP2C19-inhibitor: | 0.296 | CYP2C19-substrate: | 0.865 |
CYP2C9-inhibitor: | 0.747 | CYP2C9-substrate: | 0.118 |
CYP2D6-inhibitor: | 0.02 | CYP2D6-substrate: | 0.112 |
CYP3A4-inhibitor: | 0.72 | CYP3A4-substrate: | 0.955 |
Clearance (CL): | 10.345 | Half-life (T1/2): | 0.702 |
hERG Blockers: | 0.008 | Human Hepatotoxicity (H-HT): | 0.205 |
Drug-inuced Liver Injury (DILI): | 0.977 | AMES Toxicity: | 0.044 |
Rat Oral Acute Toxicity: | 0.748 | Maximum Recommended Daily Dose: | 0.936 |
Skin Sensitization: | 0.621 | Carcinogencity: | 0.91 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
Respiratory Toxicity: | 0.528 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003439 | ![]() |
0.574 | D08EOD | ![]() |
0.264 | ||
ENC003035 | ![]() |
0.477 | D00JRA | ![]() |
0.257 | ||
ENC000993 | ![]() |
0.432 | D07RGW | ![]() |
0.255 | ||
ENC006009 | ![]() |
0.424 | D08UMH | ![]() |
0.255 | ||
ENC005509 | ![]() |
0.424 | D0Z9NZ | ![]() |
0.253 | ||
ENC003440 | ![]() |
0.388 | D05MQK | ![]() |
0.244 | ||
ENC003617 | ![]() |
0.380 | D04QZD | ![]() |
0.243 | ||
ENC000134 | ![]() |
0.347 | D0QL3P | ![]() |
0.243 | ||
ENC003595 | ![]() |
0.344 | D06BYV | ![]() |
0.242 | ||
ENC004039 | ![]() |
0.322 | D08CCE | ![]() |
0.241 |