|
Name |
[(4S)-11-(3,5-dihydroxyphenyl)undecan-4-yl] 2-[(8S)-8-acetyloxyundecyl]-4,6-dihydroxybenzoate
|
| Molecular Formula | C37H56O8 | |
| IUPAC Name* |
[(4S)-11-(3,5-dihydroxyphenyl)undecan-4-yl] 2-[(8S)-8-acetyloxyundecyl]-4,6-dihydroxybenzoate
|
|
| SMILES |
CCC[C@@H](CCCCCCCC1=C(C(=CC(=C1)O)O)C(=O)O[C@@H](CCC)CCCCCCCC2=CC(=CC(=C2)O)O)OC(=O)C
|
|
| InChI |
InChI=1S/C37H56O8/c1-4-16-33(44-27(3)38)20-14-11-7-9-13-19-29-24-32(41)26-35(42)36(29)37(43)45-34(17-5-2)21-15-10-6-8-12-18-28-22-30(39)25-31(40)23-28/h22-26,33-34,39-42H,4-21H2,1-3H3/t33-,34-/m0/s1
|
|
| InChIKey |
LCCCZIASPPCLCU-HEVIKAOCSA-N
|
|
| Synonyms |
Integracin A; 224186-03-2
|
|
| CAS | NA | |
| PubChem CID | 124354153 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 628.8 | ALogp: | 11.4 |
| HBD: | 4 | HBA: | 8 |
| Rotatable Bonds: | 25 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 134.0 | Aromatic Rings: | 2 |
| Heavy Atoms: | 45 | QED Weighted: | 0.062 |
| Caco-2 Permeability: | -5.154 | MDCK Permeability: | 0.00001830 |
| Pgp-inhibitor: | 0.075 | Pgp-substrate: | 0.018 |
| Human Intestinal Absorption (HIA): | 0.009 | 20% Bioavailability (F20%): | 1 |
| 30% Bioavailability (F30%): | 1 |
| Blood-Brain-Barrier Penetration (BBB): | 0.029 | Plasma Protein Binding (PPB): | 100.01% |
| Volume Distribution (VD): | 1.209 | Fu: | 0.77% |
| CYP1A2-inhibitor: | 0.446 | CYP1A2-substrate: | 0.152 |
| CYP2C19-inhibitor: | 0.793 | CYP2C19-substrate: | 0.047 |
| CYP2C9-inhibitor: | 0.143 | CYP2C9-substrate: | 0.994 |
| CYP2D6-inhibitor: | 0.98 | CYP2D6-substrate: | 0.41 |
| CYP3A4-inhibitor: | 0.593 | CYP3A4-substrate: | 0.06 |
| Clearance (CL): | 6.223 | Half-life (T1/2): | 0.561 |
| hERG Blockers: | 0.263 | Human Hepatotoxicity (H-HT): | 0.148 |
| Drug-inuced Liver Injury (DILI): | 0.162 | AMES Toxicity: | 0.015 |
| Rat Oral Acute Toxicity: | 0.001 | Maximum Recommended Daily Dose: | 0.982 |
| Skin Sensitization: | 0.968 | Carcinogencity: | 0.043 |
| Eye Corrosion: | 0.011 | Eye Irritation: | 0.712 |
| Respiratory Toxicity: | 0.489 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC002894 | ![]() |
0.848 | D0P1RL | ![]() |
0.313 | ||
| ENC003312 | ![]() |
0.546 | D0T9TJ | ![]() |
0.310 | ||
| ENC001482 | ![]() |
0.448 | D00MLW | ![]() |
0.288 | ||
| ENC004818 | ![]() |
0.406 | D07ILQ | ![]() |
0.265 | ||
| ENC004641 | ![]() |
0.395 | D0O1PH | ![]() |
0.263 | ||
| ENC003972 | ![]() |
0.390 | D0MM8N | ![]() |
0.263 | ||
| ENC004669 | ![]() |
0.390 | D00FGR | ![]() |
0.256 | ||
| ENC003741 | ![]() |
0.390 | D00STJ | ![]() |
0.250 | ||
| ENC001340 | ![]() |
0.389 | D0L5YV | ![]() |
0.246 | ||
| ENC004673 | ![]() |
0.386 | D00AOJ | ![]() |
0.245 | ||